Difference between revisions of "PWY-7277"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] == * smiles: ** CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1) * inchi key: ** InCh...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7277 PWY-7277] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7277 PWY-7277] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** sphingolipid biosynthesis (mammals) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''5''' reactions found over '''7''' reactions in the full pathway | |
− | * [[ | + | * [[PWY3DJ-11281]] |
− | == Reaction(s) | + | ** 0 associated gene: |
+ | * [[PWY3DJ-12]] | ||
+ | ** 0 associated gene: | ||
+ | * [[RXN-12339]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[RXN-15211]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[RXN-15212]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_12644]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33208}} | |
− | + | {{#set: common name=sphingolipid biosynthesis (mammals)}} | |
− | + | {{#set: reaction found=5}} | |
− | {{#set: | + | {{#set: total reaction=7}} |
− | {{#set: | + | {{#set: completion rate=71.0}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:24, 21 March 2018
Pathway PWY-7277
- taxonomic range:
- common name:
- sphingolipid biosynthesis (mammals)
- Synonym(s):
Reaction(s) found
5 reactions found over 7 reactions in the full pathway
- PWY3DJ-11281
- 0 associated gene:
- PWY3DJ-12
- 0 associated gene:
- RXN-12339
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-15211
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-15212
- 1 associated gene(s):
- 1 reconstruction source(s) associated: