Difference between revisions of "PWY-6446"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINAL HISTIDINAL] == * smiles: ** C1(NC=NC=1CC([CH]=O)[N+]) * inchi key: ** InChIKey=VYOIE...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6446 PWY-6446] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6446 PWY-6446] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** benzoate biosynthesis III (CoA-dependent, non-β-oxidative) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** benzoic acid biosynthesis |
| + | ** benzoate biosynthesis III (CoA-dependent, β-oxidative-independent) | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''2''' reactions found over '''5''' reactions in the full pathway |
| − | + | * [[BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN]] | |
| − | == Reaction(s) | + | ** 0 associated gene: |
| − | * [ | + | ** 1 reconstruction source(s) associated: |
| + | *** [[annotation-in-silico_annotation]] | ||
| + | * [[PWY-6457]] | ||
| + | ** 0 associated gene: | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11278 RXN-11278] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-2002 RXN-2002] | ||
== External links == | == External links == | ||
| − | * | + | * PLANTCYC : PWY-6446 |
| − | + | {{#set: taxonomic range=TAX-33090}} | |
| − | + | {{#set: common name=benzoate biosynthesis III (CoA-dependent, non-β-oxidative)}} | |
| − | + | {{#set: common name=benzoic acid biosynthesis|benzoate biosynthesis III (CoA-dependent, β-oxidative-independent)}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=5}} | |
| − | + | {{#set: completion rate=40.0}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 19:24, 21 March 2018
Pathway PWY-6446
- taxonomic range:
- common name:
- benzoate biosynthesis III (CoA-dependent, non-β-oxidative)
- Synonym(s):
- benzoic acid biosynthesis
- benzoate biosynthesis III (CoA-dependent, β-oxidative-independent)
Reaction(s) found
2 reactions found over 5 reactions in the full pathway
- BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- PWY-6457
- 0 associated gene:
Reaction(s) not found
External links
- PLANTCYC : PWY-6446
