Difference between revisions of "PWY-5706"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUDP DUDP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) * i...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5706 PWY-5706] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40553 TAX-4...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUDP DUDP] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5706 PWY-5706] ==
−
* smiles:
+
* taxonomic range:
−
** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40553 TAX-40553]
−
* inchi key:
+
−
** InChIKey=QHWZTVCCBMIIKE-SHYZEUOFSA-K
+
 
* common name:
 
* common name:
−
** dUDP
+
** alliin metabolism
−
* molecular weight:
+
−
** 385.14   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2'-deoxyuridine-5'-diphosphate
+
** allium thiosulfinates metabolism
−
** deoxyuridine-diphosphate
+
** garlic thiosulfinate metabolism
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-14220]]
+
'''1''' reactions found over '''11''' reactions in the full pathway
−
* [[ATDUDm]]
+
* [[RXN-8899]]
−
* [[ATDUD]]
+
** 0 associated gene:
−
* [[DUDPKIN-RXN]]
+
** 2 reconstruction source(s) associated:
−
== Reaction(s) known to produce the compound ==
+
*** [[annotation-experimental_annotation]]
−
* [[RXN0-722]]
+
*** [[annotation-in-silico_annotation]]
−
* [[RXN-14219]]
+
== Reaction(s) not found ==
−
* [[UDPREDUCT-RXN]]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16193 RXN-16193]
−
* [[DUTUP]]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16194 RXN-16194]
−
* [[DUTCP]]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16195 RXN-16195]
−
== Reaction(s) of unknown directionality ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16197 RXN-16197]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16198 RXN-16198]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8898 RXN-8898]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8900 RXN-8900]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8901 RXN-8901]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8902 RXN-8902]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8905 RXN-8905]
 
== External links  ==
 
== External links  ==
−
* BIGG : dudp
+
{{#set: taxonomic range=TAX-40553}}
−
* PUBCHEM:
+
{{#set: common name=alliin metabolism}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246037 25246037]
+
{{#set: common name=allium thiosulfinates metabolism|garlic thiosulfinate metabolism}}
−
* HMDB : HMDB01000
+
{{#set: reaction found=1}}
−
* LIGAND-CPD:
+
{{#set: total reaction=11}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01346 C01346]
+
{{#set: completion rate=9.0}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60471 60471]
+
−
* METABOLIGHTS : MTBLC60471
+
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))}}
+
−
{{#set: inchi key=InChIKey=QHWZTVCCBMIIKE-SHYZEUOFSA-K}}
+
−
{{#set: common name=dUDP}}
+
−
{{#set: molecular weight=385.14    }}
+
−
{{#set: common name=2'-deoxyuridine-5'-diphosphate|deoxyuridine-diphosphate}}
+
−
{{#set: consumed by=RXN-14220|ATDUDm|ATDUD|DUDPKIN-RXN}}
+
−
{{#set: produced by=RXN0-722|RXN-14219|UDPREDUCT-RXN|DUTUP|DUTCP}}
+

Latest revision as of 19:25, 21 March 2018

Pathway PWY-5706

  • taxonomic range:
  • common name:
    • alliin metabolism
  • Synonym(s):
    • allium thiosulfinates metabolism
    • garlic thiosulfinate metabolism

Reaction(s) found

1 reactions found over 11 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-5706&oldid=41479"