Difference between revisions of "CPD-2752"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11478 RXN-11478] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2752 CPD-2752] == * smiles: ** C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11478 RXN-11478] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2752 CPD-2752] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=CC=C3))
* ec number:
+
* common name:
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
+
** trans-3-hydroxycotinine-glucuronide
 +
* inchi key:
 +
** InChIKey=WALNNKZUGHYSCT-MBWYJTGFSA-M
 +
* molecular weight:
 +
** 367.335   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[Enoylglutaryl-ACP-methyl-esters]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[Glutaryl-ACP-methyl-esters]][c]
+
* [[RXN66-162]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 H+[c] '''+''' 1 NADH[c] '''+''' 1 an enoylglutaryl-[acp] methyl ester[c] '''=>''' 1 NAD+[c] '''+''' 1 a glutaryl-[acp] methyl ester[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_10778]]
+
** [[pantograph]]-[[esiliculosus]]
+
== Pathways  ==
+
* [[PWY-6519]], 8-amino-7-oxononanoate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519]
+
** '''9''' reactions found over '''11''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: ec number=EC-1.3.1.9}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820156 91820156]
{{#set: gene associated=Tiso_gene_10778}}
+
* HMDB : HMDB01204
{{#set: in pathway=PWY-6519}}
+
{{#set: smiles=C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=CC=C3))}}
{{#set: reconstruction category=orthology}}
+
{{#set: common name=trans-3-hydroxycotinine-glucuronide}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi key=InChIKey=WALNNKZUGHYSCT-MBWYJTGFSA-M}}
{{#set: reconstruction source=esiliculosus}}
+
{{#set: molecular weight=367.335    }}
 +
{{#set: produced by=RXN66-162}}

Latest revision as of 19:25, 21 March 2018

Metabolite CPD-2752

  • smiles:
    • C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=CC=C3))
  • common name:
    • trans-3-hydroxycotinine-glucuronide
  • inchi key:
    • InChIKey=WALNNKZUGHYSCT-MBWYJTGFSA-M
  • molecular weight:
    • 367.335
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=CC=C3))" cannot be used as a page name in this wiki.