Difference between revisions of "CPD-2752"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6446 PWY-6446] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2752 CPD-2752] == * smiles: ** C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=...")
 
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6446 PWY-6446] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2752 CPD-2752] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=CC=C3))
 
* common name:
 
* common name:
−
** benzoate biosynthesis III (CoA-dependent, non-β-oxidative)
+
** trans-3-hydroxycotinine-glucuronide
 +
* inchi key:
 +
** InChIKey=WALNNKZUGHYSCT-MBWYJTGFSA-M
 +
* molecular weight:
 +
** 367.335   
 
* Synonym(s):
 
* Synonym(s):
−
** benzoic acid biosynthesis
 
−
** benzoate biosynthesis III (CoA-dependent, β-oxidative-independent)
 
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''2''' reactions found over '''5''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN]]
+
* [[RXN66-162]]
−
** 0 associated gene:
+
== Reaction(s) of unknown directionality ==
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
* [[PWY-6457]]
+
−
** 0 associated gene:
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11278 RXN-11278]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-2002 RXN-2002]
+
 
== External links  ==
 
== External links  ==
−
* PLANTCYC : PWY-6446
+
* PUBCHEM:
−
{{#set: taxonomic range=TAX-33090}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820156 91820156]
−
{{#set: common name=benzoate biosynthesis III (CoA-dependent, non-β-oxidative)}}
+
* HMDB : HMDB01204
−
{{#set: common name=benzoic acid biosynthesis|benzoate biosynthesis III (CoA-dependent, β-oxidative-independent)}}
+
{{#set: smiles=C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=CC=C3))}}
−
{{#set: reaction found=2}}
+
{{#set: common name=trans-3-hydroxycotinine-glucuronide}}
−
{{#set: total reaction=5}}
+
{{#set: inchi key=InChIKey=WALNNKZUGHYSCT-MBWYJTGFSA-M}}
−
{{#set: completion rate=40.0}}
+
{{#set: molecular weight=367.335    }}
 +
{{#set: produced by=RXN66-162}}

Latest revision as of 19:25, 21 March 2018

Metabolite CPD-2752

  • smiles:
    • C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=CC=C3))
  • common name:
    • trans-3-hydroxycotinine-glucuronide
  • inchi key:
    • InChIKey=WALNNKZUGHYSCT-MBWYJTGFSA-M
  • molecular weight:
    • 367.335
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=CC=C3))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-2752&oldid=41480"