Difference between revisions of "CPD-18011"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12871 RXN-12871] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18011 CPD-18011] == * smiles: ** C(C(OC1(OC(C(O)C(C1O)O)CO))COP([O-])([O-])=O)O * common na...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18011 CPD-18011] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C(OC1(OC(C(O)C(C1O)O)CO))COP([O-])([O-])=O)O |
| + | * common name: | ||
| + | ** 2-O-(α-D-glucopyranosyl)-sn-glycerol 3-phosphate | ||
| + | * inchi key: | ||
| + | ** InChIKey=PLJAVYDLNJODGD-NZJLWHDDSA-L | ||
| + | * molecular weight: | ||
| + | ** 332.2 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[2.4.1.213-RXN]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658883 90658883] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87089 87089] |
| − | {{#set: | + | {{#set: smiles=C(C(OC1(OC(C(O)C(C1O)O)CO))COP([O-])([O-])=O)O}} |
| + | {{#set: common name=2-O-(α-D-glucopyranosyl)-sn-glycerol 3-phosphate}} | ||
| + | {{#set: inchi key=InChIKey=PLJAVYDLNJODGD-NZJLWHDDSA-L}} | ||
| + | {{#set: molecular weight=332.2 }} | ||
| + | {{#set: reversible reaction associated=2.4.1.213-RXN}} | ||
Latest revision as of 19:25, 21 March 2018
Contents
Metabolite CPD-18011
- smiles:
- C(C(OC1(OC(C(O)C(C1O)O)CO))COP([O-])([O-])=O)O
- common name:
- 2-O-(α-D-glucopyranosyl)-sn-glycerol 3-phosphate
- inchi key:
- InChIKey=PLJAVYDLNJODGD-NZJLWHDDSA-L
- molecular weight:
- 332.2
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(OC1(OC(C(O)C(C1O)O)CO))COP([O-])([O-])=O)O" cannot be used as a page name in this wiki.
