|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Pathway]] | + | [[Category:Metabolite]] |
− | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18011 CPD-18011] == |
− | * taxonomic range: | + | * smiles: |
− | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1762 TAX-1762] | + | ** C(C(OC1(OC(C(O)C(C1O)O)CO))COP([O-])([O-])=O)O |
| * common name: | | * common name: |
− | ** mycolate biosynthesis | + | ** 2-O-(α-D-glucopyranosyl)-sn-glycerol 3-phosphate |
| + | * inchi key: |
| + | ** InChIKey=PLJAVYDLNJODGD-NZJLWHDDSA-L |
| + | * molecular weight: |
| + | ** 332.2 |
| * Synonym(s): | | * Synonym(s): |
| | | |
− | == Reaction(s) found == | + | == Reaction(s) known to consume the compound == |
− | '''86''' reactions found over '''182''' reactions in the full pathway
| + | == Reaction(s) known to produce the compound == |
− | * [[RXN-10059]]
| + | == Reaction(s) of unknown directionality == |
− | ** 4 associated gene(s):
| + | * [[2.4.1.213-RXN]] |
− | *** [[Tiso_gene_5939]]
| + | |
− | *** [[Tiso_gene_14485]]
| + | |
− | *** [[Tiso_gene_19302]]
| + | |
− | *** [[Tiso_gene_15991]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN-10060]]
| + | |
− | ** 2 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | *** [[Tiso_gene_9885]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN-10061]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_6884]]
| + | |
− | ** 2 reconstruction source(s) associated:
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | * [[RXN-10062]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-1003]]
| + | |
− | ** 3 associated gene(s):
| + | |
− | *** [[Tiso_gene_14485]]
| + | |
− | *** [[Tiso_gene_19302]]
| + | |
− | *** [[Tiso_gene_15991]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-1050]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-1053]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-1057]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-1084]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_6884]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | * [[RXN1G-1117]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-1130]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-1247]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-132]]
| + | |
− | ** 3 associated gene(s):
| + | |
− | *** [[Tiso_gene_19302]]
| + | |
− | *** [[Tiso_gene_14485]]
| + | |
− | *** [[Tiso_gene_15991]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-1325]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-138]]
| + | |
− | ** 3 associated gene(s):
| + | |
− | *** [[Tiso_gene_15991]]
| + | |
− | *** [[Tiso_gene_14485]]
| + | |
− | *** [[Tiso_gene_19302]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-1435]]
| + | |
− | ** 2 associated gene(s):
| + | |
− | *** [[Tiso_gene_10840]]
| + | |
− | *** [[Tiso_gene_14220]]
| + | |
− | ** 2 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-1436]]
| + | |
− | ** 2 associated gene(s):
| + | |
− | *** [[Tiso_gene_14220]]
| + | |
− | *** [[Tiso_gene_10840]]
| + | |
− | ** 2 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-1437]]
| + | |
− | ** 2 associated gene(s):
| + | |
− | *** [[Tiso_gene_10840]]
| + | |
− | *** [[Tiso_gene_14220]]
| + | |
− | ** 2 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-1438]]
| + | |
− | ** 2 associated gene(s):
| + | |
− | *** [[Tiso_gene_14220]]
| + | |
− | *** [[Tiso_gene_10840]]
| + | |
− | ** 2 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-1439]]
| + | |
− | ** 2 associated gene(s):
| + | |
− | *** [[Tiso_gene_14220]]
| + | |
− | *** [[Tiso_gene_10840]]
| + | |
− | ** 2 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-163]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-171]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-182]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-184]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-193]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-196]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-203]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-210]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-218]]
| + | |
− | ** 3 associated gene(s):
| + | |
− | *** [[Tiso_gene_19302]]
| + | |
− | *** [[Tiso_gene_14485]]
| + | |
− | *** [[Tiso_gene_15991]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-220]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_6884]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | * [[RXN1G-236]]
| + | |
− | ** 3 associated gene(s):
| + | |
− | *** [[Tiso_gene_19302]]
| + | |
− | *** [[Tiso_gene_14485]]
| + | |
− | *** [[Tiso_gene_15991]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-240]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-248]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-252]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-2544]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_7622]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-26]]
| + | |
− | ** 3 associated gene(s):
| + | |
− | *** [[Tiso_gene_15991]]
| + | |
− | *** [[Tiso_gene_19302]]
| + | |
− | *** [[Tiso_gene_14485]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-260]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-262]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-276]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-285]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-287]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-299]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-306]]
| + | |
− | ** 3 associated gene(s):
| + | |
− | *** [[Tiso_gene_14485]]
| + | |
− | *** [[Tiso_gene_19302]]
| + | |
− | *** [[Tiso_gene_15991]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-320]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_6884]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[manual-primary_network]]
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | * [[RXN1G-324]]
| + | |
− | ** 3 associated gene(s):
| + | |
− | *** [[Tiso_gene_19302]]
| + | |
− | *** [[Tiso_gene_15991]]
| + | |
− | *** [[Tiso_gene_14485]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-337]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-339]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-349]]
| + | |
− | ** 2 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | *** [[Tiso_gene_9885]]
| + | |
− | ** 4 reconstruction source(s) associated:
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[manual-primary_network]]
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-358]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-363]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_6884]]
| + | |
− | ** 2 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | * [[RXN1G-364]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-3641]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_7622]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-368]]
| + | |
− | ** 4 associated gene(s):
| + | |
− | *** [[Tiso_gene_19302]]
| + | |
− | *** [[Tiso_gene_5939]]
| + | |
− | *** [[Tiso_gene_14485]]
| + | |
− | *** [[Tiso_gene_15991]]
| + | |
− | ** 4 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[manual-primary_network]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-37]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-384]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-395]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-396]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-408]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-409]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-4355]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_5029]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-445]]
| + | |
− | ** 4 associated gene(s):
| + | |
− | *** [[Tiso_gene_19302]]
| + | |
− | *** [[Tiso_gene_14485]]
| + | |
− | *** [[Tiso_gene_15991]]
| + | |
− | *** [[Tiso_gene_5939]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-468]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-469]]
| + | |
− | ** 2 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | *** [[Tiso_gene_9885]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-471]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-481]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-488]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-499]]
| + | |
− | ** 4 associated gene(s):
| + | |
− | *** [[Tiso_gene_19302]]
| + | |
− | *** [[Tiso_gene_14485]]
| + | |
− | *** [[Tiso_gene_15991]]
| + | |
− | *** [[Tiso_gene_5939]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-508]]
| + | |
− | ** 2 associated gene(s):
| + | |
− | *** [[Tiso_gene_9885]]
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-509]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-517]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_6884]]
| + | |
− | ** 2 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | * [[RXN1G-526]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-607]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-613]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-617]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-637]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-679]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-686]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-717]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-72]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-820]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-840]]
| + | |
− | ** 3 associated gene(s):
| + | |
− | *** [[Tiso_gene_14485]]
| + | |
− | *** [[Tiso_gene_15991]]
| + | |
− | *** [[Tiso_gene_19302]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-853]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-881]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-915]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-951]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_13083]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN1G-962]]
| + | |
− | ** 1 associated gene(s):
| + | |
− | *** [[Tiso_gene_10778]]
| + | |
− | ** 1 reconstruction source(s) associated:
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | == Reaction(s) not found == | + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15338 RXN-15338] | + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15339 RXN-15339]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15340 RXN-15340]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15342 RXN-15342]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1004 RXN1G-1004]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1015 RXN1G-1015]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1081 RXN1G-1081]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1149 RXN1G-1149]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1150 RXN1G-1150]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1151 RXN1G-1151]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1152 RXN1G-1152]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1212 RXN1G-1212]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-127 RXN1G-127]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1278 RXN1G-1278]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-137 RXN1G-137]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1486 RXN1G-1486]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1527 RXN1G-1527]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1528 RXN1G-1528]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1529 RXN1G-1529]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1530 RXN1G-1530]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1633 RXN1G-1633]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1634 RXN1G-1634]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1635 RXN1G-1635]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1636 RXN1G-1636]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1637 RXN1G-1637]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-172 RXN1G-172]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-181 RXN1G-181]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-188 RXN1G-188]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-202 RXN1G-202]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-214 RXN1G-214]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-2527 RXN1G-2527]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-266 RXN1G-266]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-27 RXN1G-27]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-279 RXN1G-279]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-288 RXN1G-288]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-289 RXN1G-289]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-290 RXN1G-290]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-291 RXN1G-291]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-292 RXN1G-292]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-294 RXN1G-294]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-295 RXN1G-295]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-296 RXN1G-296]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-297 RXN1G-297]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-30 RXN1G-30]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-308 RXN1G-308]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-309 RXN1G-309]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-32 RXN1G-32]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-3232 RXN1G-3232]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-3256 RXN1G-3256]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-334 RXN1G-334]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-355 RXN1G-355]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-3613 RXN1G-3613]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-3660 RXN1G-3660]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-3667 RXN1G-3667]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-374 RXN1G-374]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-377 RXN1G-377]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-3993 RXN1G-3993]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-4140 RXN1G-4140]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-4141 RXN1G-4141]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-4142 RXN1G-4142]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-4143 RXN1G-4143]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-420 RXN1G-420]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-424 RXN1G-424]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-425 RXN1G-425]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-440 RXN1G-440]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-45 RXN1G-45]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-464 RXN1G-464]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-470 RXN1G-470]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-472 RXN1G-472]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-473 RXN1G-473]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-474 RXN1G-474]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-53 RXN1G-53]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-536 RXN1G-536]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-554 RXN1G-554]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-557 RXN1G-557]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-580 RXN1G-580]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-582 RXN1G-582]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-645 RXN1G-645]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-648 RXN1G-648]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-660 RXN1G-660]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-674 RXN1G-674]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-760 RXN1G-760]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-79 RXN1G-79]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-807 RXN1G-807]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-808 RXN1G-808]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-809 RXN1G-809]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-810 RXN1G-810]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-811 RXN1G-811]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-818 RXN1G-818]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-874 RXN1G-874]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-883 RXN1G-883]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-884 RXN1G-884]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-89 RXN1G-89]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-912 RXN1G-912]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-94 RXN1G-94]
| + | |
− | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-98 RXN1G-98]
| + | |
| == External links == | | == External links == |
− | {{#set: taxonomic range=TAX-1762}} | + | * PUBCHEM: |
− | {{#set: common name=mycolate biosynthesis}} | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658883 90658883] |
− | {{#set: reaction found=86}} | + | * CHEBI: |
− | {{#set: total reaction=182}} | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87089 87089] |
− | {{#set: completion rate=47.0}} | + | {{#set: smiles=C(C(OC1(OC(C(O)C(C1O)O)CO))COP([O-])([O-])=O)O}} |
| + | {{#set: common name=2-O-(α-D-glucopyranosyl)-sn-glycerol 3-phosphate}} |
| + | {{#set: inchi key=InChIKey=PLJAVYDLNJODGD-NZJLWHDDSA-L}} |
| + | {{#set: molecular weight=332.2 }} |
| + | {{#set: reversible reaction associated=2.4.1.213-RXN}} |