Difference between revisions of "CPD-15172"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5651 PWY-5651] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] == * smiles: ** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3))) * co...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] == |
| − | * | + | * smiles: |
| − | ** | + | ** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3))) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 6,7-dehydrobaicalein |
| + | * inchi key: | ||
| + | ** InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N | ||
| + | * molecular weight: | ||
| + | ** 268.225 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-14240]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86200952 86200952] | |
| − | {{#set: | + | {{#set: smiles=C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))}} |
| − | {{#set: common name= | + | {{#set: common name=6,7-dehydrobaicalein}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N}} |
| − | {{#set: | + | {{#set: molecular weight=268.225 }} |
| − | {{#set: | + | {{#set: produced by=RXN-14240}} |
Latest revision as of 19:25, 21 March 2018
Contents
Metabolite CPD-15172
- smiles:
- C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))
- common name:
- 6,7-dehydrobaicalein
- inchi key:
- InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N
- molecular weight:
- 268.225
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
