Difference between revisions of "STRICTOSIDINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5242 RXN-5242] == * direction: ** LEFT-TO-RIGHT * common name: ** ent-kaurenol 19-dehydrogenase...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=STRICTOSIDINE STRICTOSIDINE] == * smiles: ** C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3)))...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5242 RXN-5242] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=STRICTOSIDINE STRICTOSIDINE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))
 
* common name:
 
* common name:
−
** ent-kaurenol 19-dehydrogenase
+
** strictosidine
 +
* inchi key:
 +
** InChIKey=XBAMJZTXGWPTRM-AWTFMMIESA-O
 +
* molecular weight:
 +
** 531.581   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-α(S)-strictosidine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[PROTON]][c] '''+''' 1 [[ENT-KAUR-16-EN-19-OL]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 2 [[WATER]][c] '''+''' 1 [[ENT-KAUR-16-EN-19-AL]][c] '''+''' 1 [[NADP]][c]
+
* [[STRICTOSIDINE-SYNTHASE-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 ent-kaurenol[c] '''+''' 1 NADPH[c] '''+''' 1 oxygen[c] '''=>''' 2 H2O[c] '''+''' 1 ent-kaurenal[c] '''+''' 1 NADP+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_8263]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
* [[Tiso_gene_1547]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
== Pathways  ==
+
−
* [[PWY-5047]], gibberellin biosynthesis IV (Gibberella fujikuroi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5047 PWY-5047]
+
−
** '''6''' reactions found over '''15''' reactions in the full pathway
+
−
* [[PWY-5034]], GA12 biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5034 PWY-5034]
+
−
** '''6''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[athaliana]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* CAS : 20824-29-7
−
** [http://www.genome.jp/dbget-bin/www_bget?R06292 R06292]
+
* PUBCHEM:
−
{{#set: direction=LEFT-TO-RIGHT}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123291 44123291]
−
{{#set: common name=ent-kaurenol 19-dehydrogenase}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_8263|Tiso_gene_1547}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17559 17559]
−
{{#set: in pathway=PWY-5047|PWY-5034}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03470 C03470]
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))}}
−
{{#set: reconstruction source=athaliana}}
+
{{#set: common name=strictosidine}}
 +
{{#set: inchi key=InChIKey=XBAMJZTXGWPTRM-AWTFMMIESA-O}}
 +
{{#set: molecular weight=531.581    }}
 +
{{#set: common name=3-α(S)-strictosidine}}
 +
{{#set: produced by=STRICTOSIDINE-SYNTHASE-RXN}}

Latest revision as of 19:25, 21 March 2018

Metabolite STRICTOSIDINE

  • smiles:
    • C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))
  • common name:
    • strictosidine
  • inchi key:
    • InChIKey=XBAMJZTXGWPTRM-AWTFMMIESA-O
  • molecular weight:
    • 531.581
  • Synonym(s):
    • 3-α(S)-strictosidine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=STRICTOSIDINE&oldid=41495"