Difference between revisions of "CPD-1063"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R5PDP R5PDP] == * direction: ** LEFT-TO-RIGHT * common name: ** ribose-phosphate diphosphokinase *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1063 CPD-1063] == * smiles: ** CSCC(O)C(O)C(=O)COP([O-])(=O)[O-] * common name: ** 5-methyl...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R5PDP R5PDP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1063 CPD-1063] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CSCC(O)C(O)C(=O)COP([O-])(=O)[O-]
 
* common name:
 
* common name:
−
** ribose-phosphate diphosphokinase
+
** 5-methylthioribulose 1-phosphate
 +
* inchi key:
 +
** InChIKey=CNSJRYUMVMWNMC-RITPCOANSA-L
 +
* molecular weight:
 +
** 258.182   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5-methylthio-5-deoxy-D-ribulose 1-phosphate
 +
** 1-phosphomethylthioribulose
 +
** methylthioribulose 1-phosphate
 +
** MTRu-1-P
 +
** 1PMT-ribulose
 +
** 1-phospho-5-S-methylthioribulose
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[CPD-15318]][c] '''+''' 1.0 [[ATP]][c] '''=>''' 1.0 [[PROTON]][c] '''+''' 1.0 [[PRPP]][c] '''+''' 1.0 [[AMP]][c]
+
* [[M5TRPI]]
−
* With common name(s):
+
* [[5.3.1.23-RXN]]
−
** 1.0 α-D-ribose 5-phosphate[c] '''+''' 1.0 ATP[c] '''=>''' 1.0 H+[c] '''+''' 1.0 5-phospho-α-D-ribose 1-diphosphate[c] '''+''' 1.0 AMP[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_4677]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* BIGG : 5mdru1p
−
{{#set: common name=ribose-phosphate diphosphokinase}}
+
* PUBCHEM:
−
{{#set: gene associated=Tiso_gene_4677}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615271 23615271]
−
{{#set: in pathway=}}
+
* HMDB : HMDB01299
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04582 C04582]
−
{{#set: reconstruction source=creinhardtii}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.19951215.html 19951215]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58548 58548]
 +
* METABOLIGHTS : MTBLC58548
 +
{{#set: smiles=CSCC(O)C(O)C(=O)COP([O-])(=O)[O-]}}
 +
{{#set: common name=5-methylthioribulose 1-phosphate}}
 +
{{#set: inchi key=InChIKey=CNSJRYUMVMWNMC-RITPCOANSA-L}}
 +
{{#set: molecular weight=258.182    }}
 +
{{#set: common name=5-methylthio-5-deoxy-D-ribulose 1-phosphate|1-phosphomethylthioribulose|methylthioribulose 1-phosphate|MTRu-1-P|1PMT-ribulose|1-phospho-5-S-methylthioribulose}}
 +
{{#set: produced by=M5TRPI|5.3.1.23-RXN}}

Latest revision as of 19:25, 21 March 2018

Metabolite CPD-1063

  • smiles:
    • CSCC(O)C(O)C(=O)COP([O-])(=O)[O-]
  • common name:
    • 5-methylthioribulose 1-phosphate
  • inchi key:
    • InChIKey=CNSJRYUMVMWNMC-RITPCOANSA-L
  • molecular weight:
    • 258.182
  • Synonym(s):
    • 5-methylthio-5-deoxy-D-ribulose 1-phosphate
    • 1-phosphomethylthioribulose
    • methylthioribulose 1-phosphate
    • MTRu-1-P
    • 1PMT-ribulose
    • 1-phospho-5-S-methylthioribulose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CSCC(O)C(O)C(=O)COP([O-])(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-1063&oldid=41517"