Difference between revisions of "Tiso gene 14344"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18011 CPD-18011] == * smiles: ** C(C(OC1(OC(C(O)C(C1O)O)CO))COP([O-])([O-])=O)O * common na...") |
(Created page with "Category:Gene == Gene Tiso_gene_14344 == * right end position: ** 5704 * transcription direction: ** POSITIVE * left end position: ** 4144 * centisome position: ** 72.5871...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_14344 == |
− | * | + | * right end position: |
− | ** | + | ** 5704 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 4144 |
− | * | + | * centisome position: |
− | ** | + | ** 72.58714 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[3.1.26.5-RXN]] | |
− | == | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
+ | * Reaction: [[RXN0-6480]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY0-1479]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=5704}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=4144}} | |
− | + | {{#set: centisome position=72.58714 }} | |
− | {{#set: | + | {{#set: reaction associated=3.1.26.5-RXN|RXN0-6480}} |
− | {{#set: | + | {{#set: pathway associated=PWY0-1479}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:25, 21 March 2018
Gene Tiso_gene_14344
- right end position:
- 5704
- transcription direction:
- POSITIVE
- left end position:
- 4144
- centisome position:
- 72.58714
- Synonym(s):
Reactions associated
- Reaction: 3.1.26.5-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN0-6480
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation