Difference between revisions of "TRIPEPTIDES"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2752 CPD-2752] == * smiles: ** C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRIPEPTIDES TRIPEPTIDES] == * common name: ** a tripeptide * Synonym(s): == Reaction(s) known...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2752 CPD-2752] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRIPEPTIDES TRIPEPTIDES] ==
* smiles:
+
** C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=CC=C3))
+
* inchi key:
+
** InChIKey=WALNNKZUGHYSCT-MBWYJTGFSA-M
+
 
* common name:
 
* common name:
** trans-3-hydroxycotinine-glucuronide
+
** a tripeptide
* molecular weight:
+
** 367.335   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-162]]
+
* [[3.4.14.9-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a tripeptide}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820156 91820156]
+
{{#set: produced by=3.4.14.9-RXN}}
* HMDB : HMDB01204
+
{{#set: smiles=C2(=O)(C(OC1(C(C(C(C(O1)C([O-])=O)O)O)O))C[CH](N(C)2)C3(=CN=CC=C3))}}
+
{{#set: inchi key=InChIKey=WALNNKZUGHYSCT-MBWYJTGFSA-M}}
+
{{#set: common name=trans-3-hydroxycotinine-glucuronide}}
+
{{#set: molecular weight=367.335    }}
+
{{#set: produced by=RXN66-162}}
+

Latest revision as of 19:25, 21 March 2018

Metabolite TRIPEPTIDES

  • common name:
    • a tripeptide
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links