Difference between revisions of "CPD0-882"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-882 CPD0-882] == * smiles: ** CC(C([O-])=O)OC2(C(O)C1(COC(O1)C(NC(C)=O)2)) * common name:...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-882 CPD0-882] == |
− | * | + | * smiles: |
− | ** [ | + | ** CC(C([O-])=O)OC2(C(O)C1(COC(O1)C(NC(C)=O)2)) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** 1- | + | ** 1,6-anhydro-N-acetyl-β-muramate |
+ | * inchi key: | ||
+ | ** InChIKey=ZFEGYUMHFZOYIY-MKFCKLDKSA-M | ||
+ | * molecular weight: | ||
+ | ** 274.25 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 1,6-anhMurNAc | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN0-5226]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | == Reaction(s) | + | |
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658592 90658592] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4883322.html 4883322] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58690 58690] |
− | {{#set: | + | * BIGG : anhm |
+ | {{#set: smiles=CC(C([O-])=O)OC2(C(O)C1(COC(O1)C(NC(C)=O)2))}} | ||
+ | {{#set: common name=1,6-anhydro-N-acetyl-β-muramate}} | ||
+ | {{#set: inchi key=InChIKey=ZFEGYUMHFZOYIY-MKFCKLDKSA-M}} | ||
+ | {{#set: molecular weight=274.25 }} | ||
+ | {{#set: common name=1,6-anhMurNAc}} | ||
+ | {{#set: produced by=RXN0-5226}} |
Latest revision as of 19:25, 21 March 2018
Contents
Metabolite CPD0-882
- smiles:
- CC(C([O-])=O)OC2(C(O)C1(COC(O1)C(NC(C)=O)2))
- common name:
- 1,6-anhydro-N-acetyl-β-muramate
- inchi key:
- InChIKey=ZFEGYUMHFZOYIY-MKFCKLDKSA-M
- molecular weight:
- 274.25
- Synonym(s):
- 1,6-anhMurNAc
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C([O-])=O)OC2(C(O)C1(COC(O1)C(NC(C)=O)2))" cannot be used as a page name in this wiki.