Difference between revisions of "PWY-3162"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLOBIOSE CELLOBIOSE] == * smiles: ** C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O * inchi...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3162 PWY-3162] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-12...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3162 PWY-3162] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** L-tryptophan degradation V (side chain pathway) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''2''' reactions found over '''13''' reactions in the full pathway |
| − | == Reaction(s) | + | * [[RXN-5424]] |
| − | * [[RXN- | + | ** 5 associated gene(s): |
| − | * [[ | + | *** [[Tiso_gene_6562]] |
| − | == | + | *** [[Tiso_gene_6563]] |
| + | *** [[Tiso_gene_7649]] | ||
| + | *** [[Tiso_gene_5424]] | ||
| + | *** [[Tiso_gene_5425]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | * [[RXN-5581]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_7322]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-5402 RXN-5402] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-5403 RXN-5403] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-5421 RXN-5421] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-5422 RXN-5422] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-5423 RXN-5423] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-5441 RXN-5441] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-5442 RXN-5442] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-5443 RXN-5443] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-5444 RXN-5444] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-5445 RXN-5445] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-5603 RXN-5603] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-1224}} | |
| − | + | {{#set: common name=L-tryptophan degradation V (side chain pathway)}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=13}} | |
| − | + | {{#set: completion rate=15.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 20:26, 21 March 2018
Pathway PWY-3162
- taxonomic range:
- common name:
- L-tryptophan degradation V (side chain pathway)
- Synonym(s):
Reaction(s) found
2 reactions found over 13 reactions in the full pathway
- RXN-5424
- 5 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-5581
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
