Difference between revisions of "CPD-11525"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Spliced-tRNA-precursor Spliced-tRNA-precursor] == * common name: ** a spliced tRNA * Synonym(s)...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11525 CPD-11525] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Spliced-tRNA-precursor Spliced-tRNA-precursor] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11525 CPD-11525] ==
 +
* smiles:
 +
** CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
 
* common name:
 
* common name:
** a spliced tRNA
+
** OPC4-CoA
 +
* inchi key:
 +
** InChIKey=YYUZYSVPFVOYLB-UBQVUSOUSA-J
 +
* molecular weight:
 +
** 983.813   
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10707]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.160-RXN]]
+
* [[RXN-10700]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a spliced tRNA}}
+
* PUBCHEM:
{{#set: produced by=2.7.1.160-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237211 44237211]
 +
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}}
 +
{{#set: common name=OPC4-CoA}}
 +
{{#set: inchi key=InChIKey=YYUZYSVPFVOYLB-UBQVUSOUSA-J}}
 +
{{#set: molecular weight=983.813    }}
 +
{{#set: consumed by=RXN-10707}}
 +
{{#set: produced by=RXN-10700}}

Latest revision as of 20:26, 21 March 2018

Metabolite CPD-11525

  • smiles:
    • CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
  • common name:
    • OPC4-CoA
  • inchi key:
    • InChIKey=YYUZYSVPFVOYLB-UBQVUSOUSA-J
  • molecular weight:
    • 983.813
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)" cannot be used as a page name in this wiki.