Difference between revisions of "OCTAPRENYL-METHYL-OH-METHOXY-BENZQ"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23S-RRNA-N2-METHYLGUANINE2445 23S-RRNA-N2-METHYLGUANINE2445] == * common name: ** an N2-methylg...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTAPRENYL-METHYL-OH-METHOXY-BENZQ OCTAPRENYL-METHYL-OH-METHOXY-BENZQ] == * smiles: ** CC(C)=CC...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTAPRENYL-METHYL-OH-METHOXY-BENZQ OCTAPRENYL-METHYL-OH-METHOXY-BENZQ] == |
+ | * smiles: | ||
+ | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(=C(C)C(O)=C(OC)C(O)=C(O)1) | ||
* common name: | * common name: | ||
− | ** | + | ** 3-demethylubiquinol-8 |
+ | * inchi key: | ||
+ | ** InChIKey=HOLCDWJWFMTVHO-WDXILIIOSA-N | ||
+ | * molecular weight: | ||
+ | ** 715.11 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-octaprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinol | ||
+ | ** OMHMB | ||
+ | ** 2-octaprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinone | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[DHHB-METHYLTRANSFER-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657734 90657734] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61705 61705] | ||
+ | * BIGG : 2omhmbl | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05815 C05815] | ||
+ | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(=C(C)C(O)=C(OC)C(O)=C(O)1)}} | ||
+ | {{#set: common name=3-demethylubiquinol-8}} | ||
+ | {{#set: inchi key=InChIKey=HOLCDWJWFMTVHO-WDXILIIOSA-N}} | ||
+ | {{#set: molecular weight=715.11 }} | ||
+ | {{#set: common name=2-octaprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinol|OMHMB|2-octaprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinone}} | ||
+ | {{#set: consumed by=DHHB-METHYLTRANSFER-RXN}} |
Latest revision as of 19:26, 21 March 2018
Contents
Metabolite OCTAPRENYL-METHYL-OH-METHOXY-BENZQ
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(=C(C)C(O)=C(OC)C(O)=C(O)1)
- common name:
- 3-demethylubiquinol-8
- inchi key:
- InChIKey=HOLCDWJWFMTVHO-WDXILIIOSA-N
- molecular weight:
- 715.11
- Synonym(s):
- 2-octaprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinol
- OMHMB
- 2-octaprenyl-3-methyl-5-hydroxy-6-methoxy-1,4-benzoquinone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links