Difference between revisions of "MTHFO"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17371 CPD-17371] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCC=CCCCCCO)COP(=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MTHFO MTHFO] == * direction: ** LEFT-TO-RIGHT * common name: ** 5-methyltetrahydrofolate:NAD+ oxido...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17371 CPD-17371] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=MTHFO MTHFO] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCC=CCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=HJEGYLSHIKPENR-DAXVLCLXSA-J
+
 
* common name:
 
* common name:
−
** 18-hydroxylinoleoyl-CoA
+
** 5-methyltetrahydrofolate:NAD+ oxidoreductase
−
* molecular weight:
+
−
** 1041.936   
+
 
* Synonym(s):
 
* Synonym(s):
−
** ω-hydroxylinoleoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-16118]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[METHYLENE-THF]][m] '''+''' 1.0 [[PROTON]][m] '''+''' 1.0 [[NADH]][m] '''=>''' 1.0 [[5-METHYL-THF]][m] '''+''' 1.0 [[NAD]][m]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 5,10-methylenetetrahydropteroyl mono-L-glutamate[m] '''+''' 1.0 H+[m] '''+''' 1.0 NADH[m] '''=>''' 1.0 N5-methyl-tetrahydropteroyl mono-L-glutamate[m] '''+''' 1.0 NAD+[m]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14582]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659898 90659898]
+
{{#set: common name=5-methyltetrahydrofolate:NAD+ oxidoreductase}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_14582}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84904 84904]
+
{{#set: in pathway=}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCC=CCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=HJEGYLSHIKPENR-DAXVLCLXSA-J}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: common name=18-hydroxylinoleoyl-CoA}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=1041.936    }}
+
−
{{#set: common name=ω-hydroxylinoleoyl-CoA}}
+
−
{{#set: consumed by=RXN-16118}}
+

Latest revision as of 20:26, 21 March 2018

Reaction MTHFO

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 5-methyltetrahydrofolate:NAD+ oxidoreductase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 5,10-methylenetetrahydropteroyl mono-L-glutamate[m] + 1.0 H+[m] + 1.0 NADH[m] => 1.0 N5-methyl-tetrahydropteroyl mono-L-glutamate[m] + 1.0 NAD+[m]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=MTHFO&oldid=41582"