Difference between revisions of "CPDQT-41"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R5PDP R5PDP] == * direction: ** LEFT-TO-RIGHT * common name: ** ribose-phosphate diphosphokinase *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-41 CPDQT-41] == * smiles: ** CSCCCCCCCCC(=O)C([O-])=O * common name: ** 10-(methylthio)-2...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-41 CPDQT-41] == |
| − | * | + | * smiles: |
| − | ** | + | ** CSCCCCCCCCC(=O)C([O-])=O |
* common name: | * common name: | ||
| − | ** | + | ** 10-(methylthio)-2-oxodecanoate |
| + | * inchi key: | ||
| + | ** InChIKey=IEZWLIJBCDCGEU-UHFFFAOYSA-M | ||
| + | * molecular weight: | ||
| + | ** 231.329 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 10-(methylthio)-2-oxo-decanoic acid | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-18201]] | |
| − | + | * [[RXNQT-4178]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237295 44237295] |
| − | {{#set: | + | * KNAPSACK : C00007651 |
| − | + | {{#set: smiles=CSCCCCCCCCC(=O)C([O-])=O}} | |
| − | {{#set: | + | {{#set: common name=10-(methylthio)-2-oxodecanoate}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=IEZWLIJBCDCGEU-UHFFFAOYSA-M}} |
| − | {{#set: | + | {{#set: molecular weight=231.329 }} |
| + | {{#set: common name=10-(methylthio)-2-oxo-decanoic acid}} | ||
| + | {{#set: produced by=RXN-18201|RXNQT-4178}} | ||
Latest revision as of 20:26, 21 March 2018
Contents
Metabolite CPDQT-41
- smiles:
- CSCCCCCCCCC(=O)C([O-])=O
- common name:
- 10-(methylthio)-2-oxodecanoate
- inchi key:
- InChIKey=IEZWLIJBCDCGEU-UHFFFAOYSA-M
- molecular weight:
- 231.329
- Synonym(s):
- 10-(methylthio)-2-oxo-decanoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- KNAPSACK : C00007651
"CSCCCCCCCCC(=O)C([O-])=O" cannot be used as a page name in this wiki.
