Difference between revisions of "PWY-7230"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-41 CPDQT-41] == * smiles: ** CSCCCCCCCCC(=O)C([O-])=O * inchi key: ** InChIKey=IEZWLIJBCD...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7230 PWY-7230] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-41 CPDQT-41] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7230 PWY-7230] ==
* smiles:
+
* taxonomic range:
** CSCCCCCCCCC(=O)C([O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
* inchi key:
+
** InChIKey=IEZWLIJBCDCGEU-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** 10-(methylthio)-2-oxodecanoate
+
** ubiquinol-6 biosynthesis from 4-aminobenzoate (eukaryotic)
* molecular weight:
+
** 231.329   
+
 
* Synonym(s):
 
* Synonym(s):
** 10-(methylthio)-2-oxo-decanoic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''12''' reactions in the full pathway
* [[RXN-18201]]
+
* [[1.18.1.2-RXN]]
* [[RXNQT-4178]]
+
** 6 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_20055]]
 +
*** [[Tiso_gene_17170]]
 +
*** [[Tiso_gene_17381]]
 +
*** [[Tiso_gene_20054]]
 +
*** [[Tiso_gene_20168]]
 +
*** [[Tiso_gene_19031]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14291 RXN-14291]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14292 RXN-14292]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14293 RXN-14293]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14294 RXN-14294]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14295 RXN-14295]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14296 RXN-14296]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14297 RXN-14297]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14298 RXN-14298]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-102 RXN3O-102]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-54 RXN3O-54]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-75 RXN3O-75]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237295 44237295]
+
{{#set: common name=ubiquinol-6 biosynthesis from 4-aminobenzoate (eukaryotic)}}
* KNAPSACK : C00007651
+
{{#set: reaction found=1}}
{{#set: smiles=CSCCCCCCCCC(=O)C([O-])=O}}
+
{{#set: total reaction=12}}
{{#set: inchi key=InChIKey=IEZWLIJBCDCGEU-UHFFFAOYSA-M}}
+
{{#set: completion rate=8.0}}
{{#set: common name=10-(methylthio)-2-oxodecanoate}}
+
{{#set: molecular weight=231.329    }}
+
{{#set: common name=10-(methylthio)-2-oxo-decanoic acid}}
+
{{#set: produced by=RXN-18201|RXNQT-4178}}
+

Latest revision as of 19:26, 21 March 2018

Pathway PWY-7230

  • taxonomic range:
  • common name:
    • ubiquinol-6 biosynthesis from 4-aminobenzoate (eukaryotic)
  • Synonym(s):

Reaction(s) found

1 reactions found over 12 reactions in the full pathway

Reaction(s) not found

External links