Difference between revisions of "Tiso gene 3855"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROKAEMPFEROL-CMPD DIHYDROKAEMPFEROL-CMPD] == * smiles: ** C1(=C(C=CC(=C1)O)C2(OC3(C(C(C2O)...")
 
(Created page with "Category:Gene == Gene Tiso_gene_3855 == * right end position: ** 4501 * transcription direction: ** POSITIVE * left end position: ** 1467 * centisome position: ** 9.21193...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROKAEMPFEROL-CMPD DIHYDROKAEMPFEROL-CMPD] ==
+
== Gene Tiso_gene_3855 ==
* smiles:
+
* right end position:
** C1(=C(C=CC(=C1)O)C2(OC3(C(C(C2O)=O)=C(O)C=C(O)C=3)))
+
** 4501
* inchi key:
+
* transcription direction:
** InChIKey=PADQINQHPQKXNL-LSDHHAIUSA-N
+
** POSITIVE
* common name:
+
* left end position:
** (+)-dihydrokaempferol
+
** 1467
* molecular weight:
+
* centisome position:
** 288.256    
+
** 9.21193    
 
* Synonym(s):
 
* Synonym(s):
** (+)-aromadendrin
 
** (2R,3R)-dihydrokaempferol
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN1F-93]]
+
* Reaction: [[KETOACYLCOATHIOL-RXN]]
* [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) known to produce the compound ==
+
*** Assignment: ec-number
* [[NARINGENIN-3-DIOXYGENASE-RXN]]
+
** Source: [[annotation-experimental_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-10699]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-10700]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-10701]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-11246]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12565]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12710]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13617]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14268]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14274]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14277]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14394]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14774]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14788]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14793]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14799]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14803]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16137]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17116]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17778]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17782]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17787]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17791]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17795]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17799]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-6435]]
 +
* [[PWY-7654]]
 +
* [[PWY66-391]]
 +
* [[PWY-7606]]
 +
* [[PWY-7337]]
 +
* [[PWY-7340]]
 +
* [[PWY-7338]]
 +
* [[PWY-7094]]
 +
* [[PWY-6946]]
 +
* [[FAO-PWY]]
 +
* [[PWY-735]]
 +
* [[PWY-5136]]
 +
* [[PWY-7726]]
 +
* [[PWY-6863]]
 +
* [[PWY-7339]]
 +
* [[PWY-6948]]
 +
* [[PWY-7288]]
 +
* [[PWY-6945]]
 
== External links  ==
 
== External links  ==
* CAS : 480-20-6
+
{{#set: right end position=4501}}
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=122850 122850]
+
{{#set: left end position=1467}}
* CHEBI:
+
{{#set: centisome position=9.21193   }}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15401 15401]
+
{{#set: reaction associated=KETOACYLCOATHIOL-RXN|RXN-10699|RXN-10700|RXN-10701|RXN-11246|RXN-12565|RXN-12710|RXN-13617|RXN-14268|RXN-14274|RXN-14277|RXN-14394|RXN-14774|RXN-14788|RXN-14793|RXN-14799|RXN-14803|RXN-16137|RXN-17116|RXN-17778|RXN-17782|RXN-17787|RXN-17791|RXN-17795|RXN-17799}}
* METABOLIGHTS : MTBLC15401
+
{{#set: pathway associated=PWY-6435|PWY-7654|PWY66-391|PWY-7606|PWY-7337|PWY-7340|PWY-7338|PWY-7094|PWY-6946|FAO-PWY|PWY-735|PWY-5136|PWY-7726|PWY-6863|PWY-7339|PWY-6948|PWY-7288|PWY-6945}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00974 C00974]
+
{{#set: smiles=C1(=C(C=CC(=C1)O)C2(OC3(C(C(C2O)=O)=C(O)C=C(O)C=3)))}}
+
{{#set: inchi key=InChIKey=PADQINQHPQKXNL-LSDHHAIUSA-N}}
+
{{#set: common name=(+)-dihydrokaempferol}}
+
{{#set: molecular weight=288.256   }}
+
{{#set: common name=(+)-aromadendrin|(2R,3R)-dihydrokaempferol}}
+
{{#set: consumed by=RXN1F-93|DIHYDROKAEMPFEROL-4-REDUCTASE-RXN}}
+
{{#set: produced by=NARINGENIN-3-DIOXYGENASE-RXN}}
+

Latest revision as of 19:26, 21 March 2018

Gene Tiso_gene_3855

  • right end position:
    • 4501
  • transcription direction:
    • POSITIVE
  • left end position:
    • 1467
  • centisome position:
    • 9.21193
  • Synonym(s):

Reactions associated

Pathways associated

External links