Difference between revisions of "CPD-201"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6002 RXN-6002] == * direction: ** LEFT-TO-RIGHT * common name: ** aldehyde_dehydrogenase * ec n...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-201 CPD-201] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C1(=CC=C(O)C=C1))=O)COP(=O)(OP(=O...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6002 RXN-6002] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-201 CPD-201] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C1(=CC=C(O)C=C1))=O)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
 
* common name:
 
* common name:
** aldehyde_dehydrogenase
+
** 4-hydroxybenzoyl-CoA
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/1.2.1.5 EC-1.2.1.5]
+
** InChIKey=LTVXPVBFJBTNIJ-TYHXJLICSA-J
 +
* molecular weight:
 +
** 883.61   
 
* Synonym(s):
 
* Synonym(s):
 +
** p-hydroxybenzoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[NAD-P-OR-NOP]][c] '''+''' 1 [[CPD-16618]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[MAL]][c] '''+''' 1 [[NADH-P-OR-NOP]][c] '''+''' 2 [[PROTON]][c]
+
* [[RXN-11246]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 NAD(P)+[c] '''+''' 1 L-malic semialdehyde[c] '''+''' 1 H2O[c] '''=>''' 1 (S)-malate[c] '''+''' 1 NAD(P)H[c] '''+''' 2 H+[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_7322]]
+
** IN-SILICO_ANNOTATION
+
***EC-NUMBER
+
** [[pantograph]]-[[esiliculosus]]
+
== Pathways  ==
+
* [[PWY-3641]], L-carnitine degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3641 PWY-3641]
+
** '''2''' reactions found over '''3''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[orthology]]
+
** Source: [[orthology-esiliculosus]]
+
*** Tool: [[pantograph]]
+
* Category: [[annotation]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=aldehyde_dehydrogenase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266585 45266585]
{{#set: ec number=EC-1.2.1.5}}
+
* HMDB : HMDB06467
{{#set: gene associated=Tiso_gene_7322}}
+
* CHEBI:
{{#set: in pathway=PWY-3641}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57356 57356]
{{#set: reconstruction category=orthology|annotation}}
+
* LIGAND-CPD:
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02949 C02949]
{{#set: reconstruction tool=pantograph|pathwaytools}}
+
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C1(=CC=C(O)C=C1))=O)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
 +
{{#set: common name=4-hydroxybenzoyl-CoA}}
 +
{{#set: inchi key=InChIKey=LTVXPVBFJBTNIJ-TYHXJLICSA-J}}
 +
{{#set: molecular weight=883.61    }}
 +
{{#set: common name=p-hydroxybenzoyl-CoA}}
 +
{{#set: produced by=RXN-11246}}

Latest revision as of 19:26, 21 March 2018

Metabolite CPD-201

  • smiles:
    • CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C1(=CC=C(O)C=C1))=O)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
  • common name:
    • 4-hydroxybenzoyl-CoA
  • inchi key:
    • InChIKey=LTVXPVBFJBTNIJ-TYHXJLICSA-J
  • molecular weight:
    • 883.61
  • Synonym(s):
    • p-hydroxybenzoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C1(=CC=C(O)C=C1))=O)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.