Difference between revisions of "CPD-17365"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_694 == * left end position: ** 27055 * transcription direction: ** POSITIVE * right end position: ** 29764 * centisome position: ** 90.7398...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17365 CPD-17365] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...") |
||
| (4 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17365 CPD-17365] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * common name: |
| − | ** | + | ** (4Z,7Z,10Z,13Z,16Z)-docosapentaenoyl-CoA |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=QKBTYZDPVNTERQ-UWVCYPHHSA-J |
| − | * | + | * molecular weight: |
| − | ** | + | ** 1075.997 |
* Synonym(s): | * Synonym(s): | ||
| + | ** (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoyl-Coa | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-17116]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193701 72193701] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76368 76368] |
| − | {{#set: | + | {{#set: smiles=CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: | + | {{#set: common name=(4Z,7Z,10Z,13Z,16Z)-docosapentaenoyl-CoA}} |
| + | {{#set: inchi key=InChIKey=QKBTYZDPVNTERQ-UWVCYPHHSA-J}} | ||
| + | {{#set: molecular weight=1075.997 }} | ||
| + | {{#set: common name=(4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoyl-Coa}} | ||
| + | {{#set: produced by=RXN-17116}} | ||
Latest revision as of 19:26, 21 March 2018
Contents
Metabolite CPD-17365
- smiles:
- CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- (4Z,7Z,10Z,13Z,16Z)-docosapentaenoyl-CoA
- inchi key:
- InChIKey=QKBTYZDPVNTERQ-UWVCYPHHSA-J
- molecular weight:
- 1075.997
- Synonym(s):
- (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoyl-Coa
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
