Difference between revisions of "RXN-6263"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-510 CPD-510] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6263 RXN-6263] == * direction: ** REVERSIBLE * common name: ** had_family_hydrolase * ec number...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6263 RXN-6263] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** had_family_hydrolase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.8.1.11 EC-3.8.1.11] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[R-2-Haloacids]][c] '''+''' 1 [[WATER]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[Halide-Anions]][c] '''+''' 1 [[R-2-Hydroxyacids]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 an (R)-2-haloacid[c] '''+''' 1 H2O[c] '''<=>''' 1 H+[c] '''+''' 1 a halide anion[c] '''+''' 1 an (R)-2-hydroxyacid[c] |
− | == | + | |
− | * [[ | + | == Genes associated with this reaction == |
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_3200]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * LIGAND-RXN: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07310 R07310] |
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: common name=had_family_hydrolase}} | |
− | + | {{#set: ec number=EC-3.8.1.11}} | |
− | + | {{#set: gene associated=Tiso_gene_3200}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:26, 21 March 2018
Contents
Reaction RXN-6263
- direction:
- REVERSIBLE
- common name:
- had_family_hydrolase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 R-2-Haloacids[c] + 1 WATER[c] <=> 1 PROTON[c] + 1 Halide-Anions[c] + 1 R-2-Hydroxyacids[c]
- With common name(s):
- 1 an (R)-2-haloacid[c] + 1 H2O[c] <=> 1 H+[c] + 1 a halide anion[c] + 1 an (R)-2-hydroxyacid[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_3200
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- LIGAND-RXN: