Difference between revisions of "RXN-10954"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-201 CPD-201] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C1(=CC=C(O)C=C1))=O)COP(=O)(OP(=O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10954 RXN-10954] == * direction: ** LEFT-TO-RIGHT * common name: ** myo-inositol-1(or_4)-monoph...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-201 CPD-201] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10954 RXN-10954] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C1(=CC=C(O)C=C1))=O)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=LTVXPVBFJBTNIJ-TYHXJLICSA-J
+
 
* common name:
 
* common name:
−
** 4-hydroxybenzoyl-CoA
+
** myo-inositol-1(or_4)-monophosphatase
−
* molecular weight:
+
* ec number:
−
** 883.61   
+
** [http://enzyme.expasy.org/EC/3.1.3.25 EC-3.1.3.25]
 
* Synonym(s):
 
* Synonym(s):
−
** p-hydroxybenzoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-11246]]
+
** 1 [[WATER]][c] '''+''' 1 [[CPD-6702]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[MYO-INOSITOL]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 1D-myo-inositol 6-monophosphate[c] '''=>''' 1 phosphate[c] '''+''' 1 myo-inositol[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_2527]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266585 45266585]
+
{{#set: common name=myo-inositol-1(or_4)-monophosphatase}}
−
* CHEBI:
+
{{#set: ec number=EC-3.1.3.25}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57356 57356]
+
{{#set: gene associated=Tiso_gene_2527}}
−
* LIGAND-CPD:
+
{{#set: in pathway=}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02949 C02949]
+
{{#set: reconstruction category=annotation}}
−
* HMDB : HMDB06467
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C1(=CC=C(O)C=C1))=O)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: inchi key=InChIKey=LTVXPVBFJBTNIJ-TYHXJLICSA-J}}
+
−
{{#set: common name=4-hydroxybenzoyl-CoA}}
+
−
{{#set: molecular weight=883.61    }}
+
−
{{#set: common name=p-hydroxybenzoyl-CoA}}
+
−
{{#set: produced by=RXN-11246}}
+

Latest revision as of 20:26, 21 March 2018

Reaction RXN-10954

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • myo-inositol-1(or_4)-monophosphatase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 1D-myo-inositol 6-monophosphate[c] => 1 phosphate[c] + 1 myo-inositol[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-10954&oldid=41650"