Difference between revisions of "CPD-510"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17262 CPD-17262] == * smiles: ** CCC=CCC=CCC=CCC=CCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-510 CPD-510] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O * common name:...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-510 CPD-510] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** α-D-glucuronate 1-phosphate |
| + | * inchi key: | ||
| + | ** InChIKey=AIQDYKMWENWVQJ-QIUUJYRFSA-K | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 271.097 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** glucuronate-1-P |
| − | ** | + | ** glucuronate-1-phosphate |
| + | ** D-glucuronate-1-P | ||
| + | ** D-glucuronate-1-phosphate | ||
| + | ** 1-phospho-α-D-glucuronate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[GLCUR1PUT]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[GLUCURONOKINASE-RXN]] | ||
| + | * [[GLCURK]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[2.7.7.44-RXN]] | ||
== External links == | == External links == | ||
| − | * | + | * LIGAND-CPD: |
| − | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05385 C05385] |
| + | * HMDB : HMDB03976 | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57897 57897] |
| − | {{#set: smiles= | + | * BIGG : glcur1p |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244365 25244365] |
| − | {{#set: molecular weight= | + | {{#set: smiles=C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O}} |
| − | {{#set: common name= | + | {{#set: common name=α-D-glucuronate 1-phosphate}} |
| − | {{#set: consumed by=RXN- | + | {{#set: inchi key=InChIKey=AIQDYKMWENWVQJ-QIUUJYRFSA-K}} |
| + | {{#set: molecular weight=271.097 }} | ||
| + | {{#set: common name=glucuronate-1-P|glucuronate-1-phosphate|D-glucuronate-1-P|D-glucuronate-1-phosphate|1-phospho-α-D-glucuronate}} | ||
| + | {{#set: consumed by=GLCUR1PUT}} | ||
| + | {{#set: produced by=GLUCURONOKINASE-RXN|GLCURK}} | ||
| + | {{#set: reversible reaction associated=2.7.7.44-RXN}} | ||
Latest revision as of 20:27, 21 March 2018
Contents
Metabolite CPD-510
- smiles:
- C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O
- common name:
- α-D-glucuronate 1-phosphate
- inchi key:
- InChIKey=AIQDYKMWENWVQJ-QIUUJYRFSA-K
- molecular weight:
- 271.097
- Synonym(s):
- glucuronate-1-P
- glucuronate-1-phosphate
- D-glucuronate-1-P
- D-glucuronate-1-phosphate
- 1-phospho-α-D-glucuronate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O" cannot be used as a page name in this wiki.
