Difference between revisions of "CPD-510"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7797 PWY-7797] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-510 CPD-510] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O * common name:...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-510 CPD-510] == |
− | * | + | * smiles: |
− | ** [ | + | ** C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O |
* common name: | * common name: | ||
− | ** | + | ** α-D-glucuronate 1-phosphate |
+ | * inchi key: | ||
+ | ** InChIKey=AIQDYKMWENWVQJ-QIUUJYRFSA-K | ||
+ | * molecular weight: | ||
+ | ** 271.097 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** glucuronate-1-P | ||
+ | ** glucuronate-1-phosphate | ||
+ | ** D-glucuronate-1-P | ||
+ | ** D-glucuronate-1-phosphate | ||
+ | ** 1-phospho-α-D-glucuronate | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[GLCUR1PUT]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[GLUCURONOKINASE-RXN]] | |
− | + | * [[GLCURK]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[2.7.7.44-RXN]] | |
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | * [ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05385 C05385] |
− | {{#set: | + | * HMDB : HMDB03976 |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57897 57897] |
+ | * BIGG : glcur1p | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244365 25244365] | ||
+ | {{#set: smiles=C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O}} | ||
+ | {{#set: common name=α-D-glucuronate 1-phosphate}} | ||
+ | {{#set: inchi key=InChIKey=AIQDYKMWENWVQJ-QIUUJYRFSA-K}} | ||
+ | {{#set: molecular weight=271.097 }} | ||
+ | {{#set: common name=glucuronate-1-P|glucuronate-1-phosphate|D-glucuronate-1-P|D-glucuronate-1-phosphate|1-phospho-α-D-glucuronate}} | ||
+ | {{#set: consumed by=GLCUR1PUT}} | ||
+ | {{#set: produced by=GLUCURONOKINASE-RXN|GLCURK}} | ||
+ | {{#set: reversible reaction associated=2.7.7.44-RXN}} |
Latest revision as of 19:27, 21 March 2018
Contents
Metabolite CPD-510
- smiles:
- C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O
- common name:
- α-D-glucuronate 1-phosphate
- inchi key:
- InChIKey=AIQDYKMWENWVQJ-QIUUJYRFSA-K
- molecular weight:
- 271.097
- Synonym(s):
- glucuronate-1-P
- glucuronate-1-phosphate
- D-glucuronate-1-P
- D-glucuronate-1-phosphate
- 1-phospho-α-D-glucuronate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O" cannot be used as a page name in this wiki.