Difference between revisions of "CPD-510"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7797 PWY-7797] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-510 CPD-510] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O * common name:...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7797 PWY-7797] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-510 CPD-510] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O
 
* common name:
 
* common name:
−
** nocardicin A biosynthesis
+
** α-D-glucuronate 1-phosphate
 +
* inchi key:
 +
** InChIKey=AIQDYKMWENWVQJ-QIUUJYRFSA-K
 +
* molecular weight:
 +
** 271.097   
 
* Synonym(s):
 
* Synonym(s):
 +
** glucuronate-1-P
 +
** glucuronate-1-phosphate
 +
** D-glucuronate-1-P
 +
** D-glucuronate-1-phosphate
 +
** 1-phospho-α-D-glucuronate
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''6''' reactions in the full pathway
+
* [[GLCUR1PUT]]
−
* [[RXN-17832]]
+
== Reaction(s) known to produce the compound ==
−
** 4 associated gene(s):
+
* [[GLUCURONOKINASE-RXN]]
−
*** [[Tiso_gene_4147]]
+
* [[GLCURK]]
−
*** [[Tiso_gene_19324]]
+
== Reaction(s) of unknown directionality ==
−
*** [[Tiso_gene_13074]]
+
* [[2.7.7.44-RXN]]
−
*** [[Tiso_gene_12875]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17831 RXN-17831]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17833 RXN-17833]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17837 RXN-17837]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17838 RXN-17838]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17843 RXN-17843]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-2}}
+
* LIGAND-CPD:
−
{{#set: common name=nocardicin A biosynthesis}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05385 C05385]
−
{{#set: reaction found=1}}
+
* HMDB : HMDB03976
−
{{#set: total reaction=6}}
+
* CHEBI:
−
{{#set: completion rate=17.0}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57897 57897]
 +
* BIGG : glcur1p
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244365 25244365]
 +
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O}}
 +
{{#set: common name=α-D-glucuronate 1-phosphate}}
 +
{{#set: inchi key=InChIKey=AIQDYKMWENWVQJ-QIUUJYRFSA-K}}
 +
{{#set: molecular weight=271.097    }}
 +
{{#set: common name=glucuronate-1-P|glucuronate-1-phosphate|D-glucuronate-1-P|D-glucuronate-1-phosphate|1-phospho-α-D-glucuronate}}
 +
{{#set: consumed by=GLCUR1PUT}}
 +
{{#set: produced by=GLUCURONOKINASE-RXN|GLCURK}}
 +
{{#set: reversible reaction associated=2.7.7.44-RXN}}

Latest revision as of 19:27, 21 March 2018

Metabolite CPD-510

  • smiles:
    • C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O
  • common name:
    • α-D-glucuronate 1-phosphate
  • inchi key:
    • InChIKey=AIQDYKMWENWVQJ-QIUUJYRFSA-K
  • molecular weight:
    • 271.097
  • Synonym(s):
    • glucuronate-1-P
    • glucuronate-1-phosphate
    • D-glucuronate-1-P
    • D-glucuronate-1-phosphate
    • 1-phospho-α-D-glucuronate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-510&oldid=41678"