Difference between revisions of "Tiso gene 3939"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] == * smiles: ** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2) * inchi key:...")
(Created page with "Category:Gene == Gene Tiso_gene_3939 == * Synonym(s): == Reactions associated == * Reaction: PEPTIDYLPROLYL-ISOMERASE-RXN ** Source: orthology-esiliculosus == Pat...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] ==
+
== Gene Tiso_gene_3939 ==
* smiles:
+
** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)
+
* inchi key:
+
** InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N
+
* common name:
+
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
+
* molecular weight:
+
** 266.253   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP
 
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-15680]]
+
* Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659074 90659074]
+
{{#set: smiles=C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)}}
+
{{#set: inchi key=InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N}}
+
{{#set: common name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: molecular weight=266.253    }}
+
{{#set: common name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP|3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione}}
+
{{#set: consumed by=RXN-15680}}
+

Latest revision as of 20:27, 21 March 2018

Gene Tiso_gene_3939

  • Synonym(s):

Reactions associated

Pathways associated

External links