Difference between revisions of "PRISTANATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9666 RXN-9666] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/3....")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRISTANATE PRISTANATE] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C * common name: ** pr...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9666 RXN-9666] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRISTANATE PRISTANATE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/3.1.2.2 EC-3.1.2.2]
+
** pristanate
 +
* inchi key:
 +
** InChIKey=PAHGJZDQXIOYTH-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 297.5   
 
* Synonym(s):
 
* Synonym(s):
 +
** pristanic-acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN66-484]]
−
** 1 [[OLEOYL-COA]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[OLEATE-CPD]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[PROTON]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 oleoyl-CoA[c] '''+''' 1 H2O[c] '''=>''' 1 oleate[c] '''+''' 1 coenzyme A[c] '''+''' 1 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_7477]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
== Pathways  ==
+
−
* [[PWY-321]], cutin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-321 PWY-321]
+
−
** '''3''' reactions found over '''16''' reactions in the full pathway
+
−
* [[PWY-6733]], sporopollenin precursors biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6733 PWY-6733]
+
−
** '''8''' reactions found over '''18''' reactions in the full pathway
+
−
* [[PWY-1121]], suberin monomers biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-1121 PWY-1121]
+
−
** '''9''' reactions found over '''19''' reactions in the full pathway
+
−
* [[PWY-5996]], oleate biosynthesis II (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5996 PWY-5996]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[athaliana]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R08176 R08176]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20849056 20849056]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEMSPIDER:
−
{{#set: ec number=EC-3.1.2.2}}
+
** [http://www.chemspider.com/Chemical-Structure.20171482.html 20171482]
−
{{#set: gene associated=Tiso_gene_7477}}
+
* CHEBI:
−
{{#set: in pathway=PWY-321|PWY-6733|PWY-1121|PWY-5996}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77268 77268]
−
{{#set: reconstruction category=orthology}}
+
{{#set: smiles=CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=pristanate}}
−
{{#set: reconstruction source=athaliana}}
+
{{#set: inchi key=InChIKey=PAHGJZDQXIOYTH-UHFFFAOYSA-M}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=297.5    }}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=pristanic-acid}}
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: consumed by=RXN66-484}}

Latest revision as of 19:27, 21 March 2018

Metabolite PRISTANATE

  • smiles:
    • CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C
  • common name:
    • pristanate
  • inchi key:
    • InChIKey=PAHGJZDQXIOYTH-UHFFFAOYSA-M
  • molecular weight:
    • 297.5
  • Synonym(s):
    • pristanic-acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PRISTANATE&oldid=41697"