Difference between revisions of "Acceptor"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8614 CPD-8614] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Acceptor Acceptor] == * common name: ** an oxidized electron acceptor * Synonym(s): ** A ** an...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8614 CPD-8614] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Acceptor Acceptor] ==
* smiles:
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C
+
* inchi key:
+
** InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N
+
 
* common name:
 
* common name:
** 4α-methyl-5α-cholesta-8-en-3-one
+
** an oxidized electron acceptor
* molecular weight:
+
** 398.671   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** A
 +
** an oxidized electron donor
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-8022]]
 +
* [[RXN-6081]]
 +
* [[GLYCERALDEHYDE-DEHYDRO-RXN]]
 +
* [[RXN-8024]]
 +
* [[RXN-12124]]
 +
* [[RXN-10981]]
 +
* [[RXN-717]]
 +
* [[RXN-775]]
 +
* [[THIOREDOXIN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-18]]
+
* [[RXN0-5063]]
 +
* [[DEOXYHYPUSINE-MONOOXYGENASE-RXN]]
 +
* [[RXN0-2023]]
 +
* [[1.3.99.23-RXN]]
 +
* [[RXN-12037]]
 +
* [[RXN-12776]]
 +
* [[RXN-8340]]
 +
* [[RXN-14480]]
 +
* [[THYROXINE-DEIODINASE-RXN]]
 +
* [[RXN-774]]
 +
* [[RXN-13445]]
 +
* [[RXN-716]]
 +
* [[RXN-10604]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-13682]]
 +
* [[NADH-DEHYDROGENASE-RXN]]
 +
* [[RXN-17487]]
 +
* [[CHD-RXN]]
 +
* [[RXN-10851]]
 +
* [[RXN-11334]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an oxidized electron acceptor}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263323 44263323]
+
{{#set: common name=A|an oxidized electron donor}}
* CHEBI:
+
{{#set: consumed by=RXN-8022|RXN-6081|GLYCERALDEHYDE-DEHYDRO-RXN|RXN-8024|RXN-12124|RXN-10981|RXN-717|RXN-775|THIOREDOXIN-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87050 87050]
+
{{#set: produced by=RXN0-5063|DEOXYHYPUSINE-MONOOXYGENASE-RXN|RXN0-2023|1.3.99.23-RXN|RXN-12037|RXN-12776|RXN-8340|RXN-14480|THYROXINE-DEIODINASE-RXN|RXN-774|RXN-13445|RXN-716|RXN-10604}}
* HMDB : HMDB12174
+
{{#set: reversible reaction associated=RXN-13682|NADH-DEHYDROGENASE-RXN|RXN-17487|CHD-RXN|RXN-10851|RXN-11334}}
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C}}
+
{{#set: inchi key=InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N}}
+
{{#set: common name=4α-methyl-5α-cholesta-8-en-3-one}}
+
{{#set: molecular weight=398.671    }}
+
{{#set: produced by=RXN66-18}}
+

Latest revision as of 19:27, 21 March 2018

Metabolite Acceptor

  • common name:
    • an oxidized electron acceptor
  • Synonym(s):
    • A
    • an oxidized electron donor

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links