Difference between revisions of "OXALATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13936 CPD-13936] == * smiles: ** CC(=O)NC1(C(OC(CO)C(C(O)1)OC2(OC(CO)C(C(O)C(NC(=O)C)2)OC3(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALATE OXALATE] == * smiles: ** C([O-])(C(=O)[O-])=O * common name: ** oxalate * inchi key: **...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALATE OXALATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C([O-])(C(=O)[O-])=O |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** oxalate |
| + | * inchi key: | ||
| + | ** InChIKey=MUBZPKHOEPUJKR-UHFFFAOYSA-L | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 88.02 |
* Synonym(s): | * Synonym(s): | ||
| + | ** oxalic acid | ||
| + | ** ethanedioic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[OXALATE-DECARBOXYLASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CAS : 144-62-7 | ||
| + | * DRUGBANK : DB02737 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71081 71081] |
| − | {{#set: smiles= | + | * HMDB : HMDB02329 |
| − | {{#set: inchi key=InChIKey= | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00209 C00209] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: consumed by= | + | ** [http://www.chemspider.com/Chemical-Structure.64235.html 64235] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30623 30623] | ||
| + | * METABOLIGHTS : MTBLC30623 | ||
| + | {{#set: smiles=C([O-])(C(=O)[O-])=O}} | ||
| + | {{#set: common name=oxalate}} | ||
| + | {{#set: inchi key=InChIKey=MUBZPKHOEPUJKR-UHFFFAOYSA-L}} | ||
| + | {{#set: molecular weight=88.02 }} | ||
| + | {{#set: common name=oxalic acid|ethanedioic acid}} | ||
| + | {{#set: consumed by=OXALATE-DECARBOXYLASE-RXN}} | ||
Latest revision as of 19:27, 21 March 2018
Contents
Metabolite OXALATE
- smiles:
- C([O-])(C(=O)[O-])=O
- common name:
- oxalate
- inchi key:
- InChIKey=MUBZPKHOEPUJKR-UHFFFAOYSA-L
- molecular weight:
- 88.02
- Synonym(s):
- oxalic acid
- ethanedioic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 144-62-7
- DRUGBANK : DB02737
- PUBCHEM:
- HMDB : HMDB02329
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC30623
"C([O-])(C(=O)[O-])=O" cannot be used as a page name in this wiki.
