Difference between revisions of "CPD-8614"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_582 == * right end position: ** 24586 * transcription direction: ** POSITIVE * left end position: ** 23226 * centisome position: ** 73.8083...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8614 CPD-8614] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8614 CPD-8614] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C |
| − | * | + | * common name: |
| − | ** | + | ** 4α-methyl-5α-cholesta-8-en-3-one |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 398.671 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN66-18]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263323 44263323] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87050 87050] |
| − | {{#set: | + | * HMDB : HMDB12174 |
| + | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C}} | ||
| + | {{#set: common name=4α-methyl-5α-cholesta-8-en-3-one}} | ||
| + | {{#set: inchi key=InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N}} | ||
| + | {{#set: molecular weight=398.671 }} | ||
| + | {{#set: produced by=RXN66-18}} | ||
Latest revision as of 20:27, 21 March 2018
Contents
Metabolite CPD-8614
- smiles:
- CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C
- common name:
- 4α-methyl-5α-cholesta-8-en-3-one
- inchi key:
- InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N
- molecular weight:
- 398.671
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C" cannot be used as a page name in this wiki.
