Difference between revisions of "PWY-6745"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALATE OXALATE] == * smiles: ** C([O-])(C(=O)[O-])=O * inchi key: ** InChIKey=MUBZPKHOEPUJKR-U...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6745 PWY-6745] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-31...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALATE OXALATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6745 PWY-6745] ==
* smiles:
+
* taxonomic range:
** C([O-])(C(=O)[O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193]
* inchi key:
+
** InChIKey=MUBZPKHOEPUJKR-UHFFFAOYSA-L
+
 
* common name:
 
* common name:
** oxalate
+
** phytochelatins biosynthesis
* molecular weight:
+
** 88.02   
+
 
* Synonym(s):
 
* Synonym(s):
** oxalic acid
+
** biosynthesis of heavy metal-binding ligands
** ethanedioic acid
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[OXALATE-DECARBOXYLASE-RXN]]
+
'''1''' reactions found over '''1''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[2.3.2.15-RXN]]
== Reaction(s) of unknown directionality ==
+
** 4 associated gene(s):
 +
*** [[Tiso_gene_17830]]
 +
*** [[Tiso_gene_9670]]
 +
*** [[Tiso_gene_12647]]
 +
*** [[Tiso_gene_9671]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* CAS : 144-62-7
+
{{#set: taxonomic range=TAX-3193}}
* DRUGBANK : DB02737
+
{{#set: common name=phytochelatins biosynthesis}}
* PUBCHEM:
+
{{#set: common name=biosynthesis of heavy metal-binding ligands}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71081 71081]
+
{{#set: reaction found=1}}
* HMDB : HMDB02329
+
{{#set: total reaction=1}}
* LIGAND-CPD:
+
{{#set: completion rate=100.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C00209 C00209]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.64235.html 64235]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30623 30623]
+
* METABOLIGHTS : MTBLC30623
+
{{#set: smiles=C([O-])(C(=O)[O-])=O}}
+
{{#set: inchi key=InChIKey=MUBZPKHOEPUJKR-UHFFFAOYSA-L}}
+
{{#set: common name=oxalate}}
+
{{#set: molecular weight=88.02    }}
+
{{#set: common name=oxalic acid|ethanedioic acid}}
+
{{#set: consumed by=OXALATE-DECARBOXYLASE-RXN}}
+

Latest revision as of 19:27, 21 March 2018

Pathway PWY-6745

  • taxonomic range:
  • common name:
    • phytochelatins biosynthesis
  • Synonym(s):
    • biosynthesis of heavy metal-binding ligands

Reaction(s) found

1 reactions found over 1 reactions in the full pathway

Reaction(s) not found

External links