Difference between revisions of "RXN-11482"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRISTANATE PRISTANATE] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C * inchi key: ** InCh...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11482 RXN-11482] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11482 RXN-11482] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9] | |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Enoylpimeloyl-ACP-methyl-esters]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[Pimeloyl-ACP-methyl-esters]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 an enoylpimeloyl-[acp] methyl ester[c] '''=>''' 1 NAD+[c] '''+''' 1 a pimeloyl-[acp] methyl ester[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_10778]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWY-6519]], 8-amino-7-oxononanoate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519] | ||
| + | ** '''9''' reactions found over '''11''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-1.3.1.9}} | |
| − | + | {{#set: gene associated=Tiso_gene_10778}} | |
| − | + | {{#set: in pathway=PWY-6519}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-esiliculosus}} | |
| − | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:27, 21 March 2018
Contents
Reaction RXN-11482
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NADH[c] + 1 PROTON[c] + 1 Enoylpimeloyl-ACP-methyl-esters[c] => 1 NAD[c] + 1 Pimeloyl-ACP-methyl-esters[c]
- With common name(s):
- 1 NADH[c] + 1 H+[c] + 1 an enoylpimeloyl-[acp] methyl ester[c] => 1 NAD+[c] + 1 a pimeloyl-[acp] methyl ester[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_10778
- Source: orthology-esiliculosus
Pathways
- PWY-6519, 8-amino-7-oxononanoate biosynthesis I: PWY-6519
- 9 reactions found over 11 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
