Difference between revisions of "O-SINAPOYLCHOLINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11482 RXN-11482] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SINAPOYLCHOLINE O-SINAPOYLCHOLINE] == * smiles: ** C(COC(=O)C=CC1(C=C(OC)C(O)=C(C=1)OC))[N+](...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11482 RXN-11482] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SINAPOYLCHOLINE O-SINAPOYLCHOLINE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(COC(=O)C=CC1(C=C(OC)C(O)=C(C=1)OC))[N+](C)(C)C
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
+
** O-sinapoylcholine
 +
* inchi key:
 +
** InChIKey=HUJXHFRXWWGYQH-UHFFFAOYSA-O
 +
* molecular weight:
 +
** 310.369   
 
* Synonym(s):
 
* Synonym(s):
 +
** sinapoylcholine
 +
** sinapine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[Enoylpimeloyl-ACP-methyl-esters]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[Pimeloyl-ACP-methyl-esters]][c]
+
* [[2.3.1.91-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 an enoylpimeloyl-[acp] methyl ester[c] '''+''' 1 NADH[c] '''+''' 1 H+[c] '''=>''' 1 NAD+[c] '''+''' 1 a pimeloyl-[acp] methyl ester[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_10778]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-6519]], 8-amino-7-oxononanoate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519]
+
−
** '''9''' reactions found over '''11''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 18696-26-9
−
{{#set: ec number=EC-1.3.1.9}}
+
* PUBCHEM:
−
{{#set: gene associated=Tiso_gene_10778}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280385 5280385]
−
{{#set: in pathway=PWY-6519}}
+
* HMDB : HMDB29379
−
{{#set: reconstruction category=orthology}}
+
* CHEBI:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16353 16353]
−
{{#set: reconstruction source=esiliculosus}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C00933 C00933]
 +
{{#set: smiles=C(COC(=O)C=CC1(C=C(OC)C(O)=C(C=1)OC))[N+](C)(C)C}}
 +
{{#set: common name=O-sinapoylcholine}}
 +
{{#set: inchi key=InChIKey=HUJXHFRXWWGYQH-UHFFFAOYSA-O}}
 +
{{#set: molecular weight=310.369    }}
 +
{{#set: common name=sinapoylcholine|sinapine}}
 +
{{#set: produced by=2.3.1.91-RXN}}

Latest revision as of 20:28, 21 March 2018

Metabolite O-SINAPOYLCHOLINE

  • smiles:
    • C(COC(=O)C=CC1(C=C(OC)C(O)=C(C=1)OC))[N+](C)(C)C
  • common name:
    • O-sinapoylcholine
  • inchi key:
    • InChIKey=HUJXHFRXWWGYQH-UHFFFAOYSA-O
  • molecular weight:
    • 310.369
  • Synonym(s):
    • sinapoylcholine
    • sinapine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(COC(=O)C=CC1(C=C(OC)C(O)=C(C=1)OC))[N+](C)(C)C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=O-SINAPOYLCHOLINE&oldid=41774"