Difference between revisions of "CPD-14873"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2001 RXN-2001] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/6....")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14873 CPD-14873] == * smiles: ** C(=O)([O-])C1(C=C(N)C(O)=CC=1) * common name: ** 3-amino-4...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2001 RXN-2001] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14873 CPD-14873] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(=O)([O-])C1(C=C(N)C(O)=CC=1)
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/6.2.1 EC-6.2.1]
+
** 3-amino-4-hydroxybenzoate
 +
* inchi key:
 +
** InChIKey=MRBKRZAPGUCWOS-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 152.129   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-amino-4-hydroxybenzoic acid
 +
** 3,4-AHBA
 +
** 5-amino saliciylic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CPD-674]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[CINNAMOYL-COA]][c] '''+''' 1 [[PPI]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-13870]]
−
** 1 trans-cinnamate[c] '''+''' 1 coenzyme A[c] '''+''' 1 ATP[c] '''=>''' 1 AMP[c] '''+''' 1 (E)-cinnamoyl-CoA[c] '''+''' 1 diphosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_14183]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_12275]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-6457]], trans-cinnamoyl-CoA biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6457 PWY-6457]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[athaliana]]
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R02255 R02255]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54694272 54694272]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEMSPIDER:
−
{{#set: ec number=EC-6.2.1}}
+
** [http://www.chemspider.com/Chemical-Structure.58593.html 58593]
−
{{#set: gene associated=Tiso_gene_14183|Tiso_gene_12275}}
+
* CHEBI:
−
{{#set: in pathway=PWY-6457}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60005 60005]
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C12115 C12115]
−
{{#set: reconstruction source=athaliana|esiliculosus}}
+
{{#set: smiles=C(=O)([O-])C1(C=C(N)C(O)=CC=1)}}
 +
{{#set: common name=3-amino-4-hydroxybenzoate}}
 +
{{#set: inchi key=InChIKey=MRBKRZAPGUCWOS-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=152.129    }}
 +
{{#set: common name=3-amino-4-hydroxybenzoic acid|3,4-AHBA|5-amino saliciylic acid}}
 +
{{#set: reversible reaction associated=RXN-13870}}

Latest revision as of 19:28, 21 March 2018

Metabolite CPD-14873

  • smiles:
    • C(=O)([O-])C1(C=C(N)C(O)=CC=1)
  • common name:
    • 3-amino-4-hydroxybenzoate
  • inchi key:
    • InChIKey=MRBKRZAPGUCWOS-UHFFFAOYSA-M
  • molecular weight:
    • 152.129
  • Synonym(s):
    • 3-amino-4-hydroxybenzoic acid
    • 3,4-AHBA
    • 5-amino saliciylic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])C1(C=C(N)C(O)=CC=1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-14873&oldid=41798"