Difference between revisions of "PWY-5147"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1163 CPD0-1163] == * smiles: ** CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5147 PWY-5147] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1163 CPD0-1163] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5147 PWY-5147] ==
* smiles:
+
* taxonomic range:
** CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33682 TAX-33682]
** InChIKey=KJJPUIFALMAQPF-SUAKZGBESA-J
+
 
* common name:
 
* common name:
** (S)-3-hydroxy-(5Z)-tetradecenoyl-CoA
+
** oleate biosynthesis I (plants)
* molecular weight:
+
** 987.845   
+
 
* Synonym(s):
 
* Synonym(s):
** (S)-3-hydroxy-5-cis-tetradecenoyl-CoA
+
** stearoyl-ACP desaturation pathway
** (S)-3-hydroxy-14:1-Δ5-CoA
+
** (3S)-hydroxy-5-cis-tetradecenoyl-CoA
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-14393]]
+
'''3''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[3.1.2.14-RXN]]
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-7903]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_6179]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-9644]]
 +
** 9 associated gene(s):
 +
*** [[Tiso_gene_4191]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_7855]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_348]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_9394]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ARACYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244729 25244729]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5147 PWY-5147]
{{#set: smiles=CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: taxonomic range=TAX-33090}}
{{#set: inchi key=InChIKey=KJJPUIFALMAQPF-SUAKZGBESA-J}}
+
{{#set: taxonomic range=TAX-33682}}
{{#set: common name=(S)-3-hydroxy-(5Z)-tetradecenoyl-CoA}}
+
{{#set: common name=oleate biosynthesis I (plants)}}
{{#set: molecular weight=987.845    }}
+
{{#set: common name=stearoyl-ACP desaturation pathway}}
{{#set: common name=(S)-3-hydroxy-5-cis-tetradecenoyl-CoA|(S)-3-hydroxy-14:1-Δ5-CoA|(3S)-hydroxy-5-cis-tetradecenoyl-CoA}}
+
{{#set: reaction found=3}}
{{#set: consumed by=RXN-14393}}
+
{{#set: total reaction=3}}
 +
{{#set: completion rate=100.0}}

Latest revision as of 19:28, 21 March 2018

Pathway PWY-5147

  • taxonomic range:
  • common name:
    • oleate biosynthesis I (plants)
  • Synonym(s):
    • stearoyl-ACP desaturation pathway

Reaction(s) found

3 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links