Difference between revisions of "PWY-4041"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SINAPOYLCHOLINE O-SINAPOYLCHOLINE] == * smiles: ** C(COC(=O)C=CC1(C=C(OC)C(O)=C(C=1)OC))[N+](...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4041 PWY-4041] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SINAPOYLCHOLINE O-SINAPOYLCHOLINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4041 PWY-4041] ==
* smiles:
+
* taxonomic range:
** C(COC(=O)C=CC1(C=C(OC)C(O)=C(C=1)OC))[N+](C)(C)C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 
* common name:
 
* common name:
** O-sinapoylcholine
+
** γ-glutamyl cycle
* inchi key:
+
** InChIKey=HUJXHFRXWWGYQH-UHFFFAOYSA-O
+
* molecular weight:
+
** 310.369   
+
 
* Synonym(s):
 
* Synonym(s):
** sinapoylcholine
+
** glutathione metabolism
** sinapine
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''5''' reactions found over '''6''' reactions in the full pathway
* [[2.3.1.91-RXN]]
+
* [[5-OXOPROLINASE-ATP-HYDROLYSING-RXN]]
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_3358]]
 +
*** [[Tiso_gene_3359]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
* [[GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_1247]]
 +
*** [[Tiso_gene_1510]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[GLUTATHIONESYN-PWY]]
 +
** 0 associated gene:
 +
* [[RXN-6601]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_12321]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-6622]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_2704]]
 +
*** [[Tiso_gene_860]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* CAS : 18696-26-9
+
{{#set: taxonomic range=TAX-33208}}
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280385 5280385]
+
{{#set: common name=γ-glutamyl cycle}}
* HMDB : HMDB29379
+
{{#set: common name=glutathione metabolism}}
* CHEBI:
+
{{#set: reaction found=5}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16353 16353]
+
{{#set: total reaction=6}}
* LIGAND-CPD:
+
{{#set: completion rate=83.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C00933 C00933]
+
{{#set: smiles=C(COC(=O)C=CC1(C=C(OC)C(O)=C(C=1)OC))[N+](C)(C)C}}
+
{{#set: common name=O-sinapoylcholine}}
+
{{#set: inchi key=InChIKey=HUJXHFRXWWGYQH-UHFFFAOYSA-O}}
+
{{#set: molecular weight=310.369    }}
+
{{#set: common name=sinapoylcholine|sinapine}}
+
{{#set: produced by=2.3.1.91-RXN}}
+

Latest revision as of 19:28, 21 March 2018

Pathway PWY-4041

  • taxonomic range:
  • common name:
    • γ-glutamyl cycle
  • Synonym(s):
    • glutathione metabolism

Reaction(s) found

5 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links