Difference between revisions of "Tiso gene 8041"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SINAPOYLCHOLINE O-SINAPOYLCHOLINE] == * smiles: ** C(COC(=O)C=CC1(C=C(OC)C(O)=C(C=1)OC))[N+](...")
(Created page with "Category:Gene == Gene Tiso_gene_8041 == * right end position: ** 3759 * transcription direction: ** NEGATIVE * left end position: ** 1 * centisome position: ** 9.450903500...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SINAPOYLCHOLINE O-SINAPOYLCHOLINE] ==
+
== Gene Tiso_gene_8041 ==
−
* smiles:
+
* right end position:
−
** C(COC(=O)C=CC1(C=C(OC)C(O)=C(C=1)OC))[N+](C)(C)C
+
** 3759
−
* inchi key:
+
* transcription direction:
−
** InChIKey=HUJXHFRXWWGYQH-UHFFFAOYSA-O
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** O-sinapoylcholine
+
** 1
−
* molecular weight:
+
* centisome position:
−
** 310.369   
+
** 9.450903500e-3
 
* Synonym(s):
 
* Synonym(s):
−
** sinapoylcholine
 
−
** sinapine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[VALINE--TRNA-LIGASE-RXN]]
−
* [[2.3.1.91-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[TRNA-CHARGING-PWY]]
 
== External links  ==
 
== External links  ==
−
* CAS : 18696-26-9
+
{{#set: right end position=3759}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280385 5280385]
+
{{#set: left end position=1}}
−
* CHEBI:
+
{{#set: centisome position=9.450903500e-3}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16353 16353]
+
{{#set: reaction associated=VALINE--TRNA-LIGASE-RXN}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=TRNA-CHARGING-PWY}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00933 C00933]
+
−
* HMDB : HMDB29379
+
−
{{#set: smiles=C(COC(=O)C=CC1(C=C(OC)C(O)=C(C=1)OC))[N+](C)(C)C}}
+
−
{{#set: inchi key=InChIKey=HUJXHFRXWWGYQH-UHFFFAOYSA-O}}
+
−
{{#set: common name=O-sinapoylcholine}}
+
−
{{#set: molecular weight=310.369    }}
+
−
{{#set: common name=sinapoylcholine|sinapine}}
+
−
{{#set: produced by=2.3.1.91-RXN}}
+

Latest revision as of 20:28, 21 March 2018

Gene Tiso_gene_8041

  • right end position:
    • 3759
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 1
  • centisome position:
    • 9.450903500e-3
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_8041&oldid=41819"