Difference between revisions of "PWY-6123"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7367 CPD-7367] == * smiles: ** [CH](=O)C1(=CC=C(O)C(N)=C1) * inchi key: ** InChIKey=LMGGPKY...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6123 PWY-6123] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6123 PWY-6123] == |
− | * | + | * taxonomic range: |
− | ** [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** inosine-5'-phosphate biosynthesis I |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** IMP biosynthesis I | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''5''' reactions found over '''6''' reactions in the full pathway | |
− | == Reaction(s) | + | * [[AICARSYN-RXN]] |
− | * [ | + | ** 0 associated gene: |
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[AICARTRANSFORM-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_18420]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[IMPCYCLOHYDROLASE-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_18420]] | ||
+ | ** 6 reconstruction source(s) associated: | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | * [[RXN0-742]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_16011]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-synechocystis]] | ||
+ | * [[SAICARSYN-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_20436]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN0-743 RXN0-743] | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6123 PWY-6123] |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=inosine-5'-phosphate biosynthesis I}} | |
− | {{#set: | + | {{#set: common name=IMP biosynthesis I}} |
− | {{#set: | + | {{#set: reaction found=5}} |
− | {{#set: common name= | + | {{#set: total reaction=6}} |
− | {{#set: | + | {{#set: completion rate=83.0}} |
− | {{#set: | + |
Latest revision as of 20:28, 21 March 2018
Pathway PWY-6123
- taxonomic range:
- common name:
- inosine-5'-phosphate biosynthesis I
- Synonym(s):
- IMP biosynthesis I
Reaction(s) found
5 reactions found over 6 reactions in the full pathway
- AICARSYN-RXN
- 0 associated gene:
- 2 reconstruction source(s) associated:
- AICARTRANSFORM-RXN
- 1 associated gene(s):
- 4 reconstruction source(s) associated:
- IMPCYCLOHYDROLASE-RXN
- 1 associated gene(s):
- 6 reconstruction source(s) associated:
- RXN0-742
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- SAICARSYN-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: