Difference between revisions of "PWY-6123"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7367 CPD-7367] == * smiles: ** [CH](=O)C1(=CC=C(O)C(N)=C1) * inchi key: ** InChIKey=LMGGPKY...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6123 PWY-6123] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7367 CPD-7367] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6123 PWY-6123] ==
* smiles:
+
* taxonomic range:
** [CH](=O)C1(=CC=C(O)C(N)=C1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=LMGGPKYAWHDOLR-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 3-amino-4-hydroxybenzaldehyde
+
** inosine-5'-phosphate biosynthesis I
* molecular weight:
+
** 137.138   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** IMP biosynthesis I
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''5''' reactions found over '''6''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[AICARSYN-RXN]]
* [[RXN-13871]]
+
** 0 associated gene:
 +
** 2 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[AICARTRANSFORM-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_18420]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[IMPCYCLOHYDROLASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_18420]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[RXN0-742]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_16011]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-synechocystis]]
 +
* [[SAICARSYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_20436]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-743 RXN0-743]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11521082 11521082]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6123 PWY-6123]
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78237 78237]
+
{{#set: common name=inosine-5'-phosphate biosynthesis I}}
{{#set: smiles=[CH](=O)C1(=CC=C(O)C(N)=C1)}}
+
{{#set: common name=IMP biosynthesis I}}
{{#set: inchi key=InChIKey=LMGGPKYAWHDOLR-UHFFFAOYSA-N}}
+
{{#set: reaction found=5}}
{{#set: common name=3-amino-4-hydroxybenzaldehyde}}
+
{{#set: total reaction=6}}
{{#set: molecular weight=137.138    }}
+
{{#set: completion rate=83.0}}
{{#set: reversible reaction associated=RXN-13871}}
+

Latest revision as of 19:28, 21 March 2018

Pathway PWY-6123

  • taxonomic range:
  • common name:
    • inosine-5'-phosphate biosynthesis I
  • Synonym(s):
    • IMP biosynthesis I

Reaction(s) found

5 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links