Difference between revisions of "CPD0-1163"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6242 CPD-6242] == * common name: ** a protein-O-(N-acetyl-D-glucosaminyl)-trans-4-hydroxy-L...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1163 CPD0-1163] == * smiles: ** CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1163 CPD0-1163] == |
+ | * smiles: | ||
+ | ** CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O | ||
* common name: | * common name: | ||
− | ** | + | ** (S)-3-hydroxy-(5Z)-tetradecenoyl-CoA |
+ | * inchi key: | ||
+ | ** InChIKey=KJJPUIFALMAQPF-SUAKZGBESA-J | ||
+ | * molecular weight: | ||
+ | ** 987.845 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (S)-3-hydroxy-5-cis-tetradecenoyl-CoA | ||
+ | ** (S)-3-hydroxy-14:1-Δ5-CoA | ||
+ | ** (3S)-hydroxy-5-cis-tetradecenoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-14393]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: consumed | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244729 25244729] |
+ | {{#set: smiles=CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} | ||
+ | {{#set: common name=(S)-3-hydroxy-(5Z)-tetradecenoyl-CoA}} | ||
+ | {{#set: inchi key=InChIKey=KJJPUIFALMAQPF-SUAKZGBESA-J}} | ||
+ | {{#set: molecular weight=987.845 }} | ||
+ | {{#set: common name=(S)-3-hydroxy-5-cis-tetradecenoyl-CoA|(S)-3-hydroxy-14:1-Δ5-CoA|(3S)-hydroxy-5-cis-tetradecenoyl-CoA}} | ||
+ | {{#set: consumed by=RXN-14393}} |
Latest revision as of 20:28, 21 March 2018
Contents
Metabolite CPD0-1163
- smiles:
- CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- common name:
- (S)-3-hydroxy-(5Z)-tetradecenoyl-CoA
- inchi key:
- InChIKey=KJJPUIFALMAQPF-SUAKZGBESA-J
- molecular weight:
- 987.845
- Synonym(s):
- (S)-3-hydroxy-5-cis-tetradecenoyl-CoA
- (S)-3-hydroxy-14:1-Δ5-CoA
- (3S)-hydroxy-5-cis-tetradecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.