Difference between revisions of "CPD66-39"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-hydroxybenzoate 4-hydroxybenzoate] == * smiles: ** C(C1(C=CC(=CC=1)O))(=O)[O-] * inchi key: *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-39 CPD66-39] == * common name: ** a 2,3,4-saturated fatty acid * Synonym(s): == Reaction...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-39 CPD66-39] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** 4- | + | ** a 2,3,4-saturated fatty acid |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[TRANS-RXN0-623]] |
| − | * [[ | + | * [[ACYLCOASYN-RXN]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[THIOESTER-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a 2,3,4-saturated fatty acid}} | |
| − | + | {{#set: consumed by=TRANS-RXN0-623|ACYLCOASYN-RXN}} | |
| − | + | {{#set: produced by=THIOESTER-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name=4- | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 19:28, 21 March 2018
Contents
Metabolite CPD66-39
- common name:
- a 2,3,4-saturated fatty acid
- Synonym(s):
