Difference between revisions of "RXN-16659"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14873 CPD-14873] == * smiles: ** C(=O)([O-])C1(C=C(N)C(O)=CC=1) * common name: ** 3-amino-4...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16659 RXN-16659] == * direction: ** LEFT-TO-RIGHT * common name: ** peptidoglycan transpeptidas...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14873 CPD-14873] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16659 RXN-16659] ==
−
* smiles:
+
* direction:
−
** C(=O)([O-])C1(C=C(N)C(O)=CC=1)
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** 3-amino-4-hydroxybenzoate
+
** peptidoglycan transpeptidase (Gram-negative bacteria)
−
* inchi key:
+
** beta-lactamase
−
** InChIKey=MRBKRZAPGUCWOS-UHFFFAOYSA-M
+
* ec number:
−
* molecular weight:
+
** [http://enzyme.expasy.org/EC/3.4.16.4 EC-3.4.16.4]
−
** 152.129   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-amino-4-hydroxybenzoic acid
 
−
** 3,4-AHBA
 
−
** 5-amino saliciylic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[CPD-17927]][c] '''+''' 1 [[CPD-17931]][c] '''=>''' 1 [[D-ALANINE]][c] '''+''' 1 [[CPD-17932]][c]
−
* [[RXN-13870]]
+
* With common name(s):
 +
** 1 a nascent peptidoglycan with (L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine) pentapeptide[c] '''+''' 1 a peptidoglycan with (L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanine) tetrapeptide[c] '''=>''' 1 D-alanine[c] '''+''' 1 a nascent peptidoglycan with D,D cross-links (meso-diaminopimelate containing)[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18870]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY0-1586]], peptidoglycan maturation (meso-diaminopimelate containing): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1586 PWY0-1586]
 +
** '''2''' reactions found over '''12''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54694272 54694272]
+
{{#set: common name=peptidoglycan transpeptidase (Gram-negative bacteria)}}
−
* CHEMSPIDER:
+
{{#set: common name=beta-lactamase}}
−
** [http://www.chemspider.com/Chemical-Structure.58593.html 58593]
+
{{#set: ec number=EC-3.4.16.4}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_18870}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60005 60005]
+
{{#set: in pathway=PWY0-1586}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C12115 C12115]
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
{{#set: smiles=C(=O)([O-])C1(C=C(N)C(O)=CC=1)}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=3-amino-4-hydroxybenzoate}}
+
−
{{#set: inchi key=InChIKey=MRBKRZAPGUCWOS-UHFFFAOYSA-M}}
+
−
{{#set: molecular weight=152.129    }}
+
−
{{#set: common name=3-amino-4-hydroxybenzoic acid|3,4-AHBA|5-amino saliciylic acid}}
+
−
{{#set: reversible reaction associated=RXN-13870}}
+

Latest revision as of 20:28, 21 March 2018

Reaction RXN-16659

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • peptidoglycan transpeptidase (Gram-negative bacteria)
    • beta-lactamase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 a nascent peptidoglycan with (L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine) pentapeptide[c] + 1 a peptidoglycan with (L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanine) tetrapeptide[c] => 1 D-alanine[c] + 1 a nascent peptidoglycan with D,D cross-links (meso-diaminopimelate containing)[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY0-1586, peptidoglycan maturation (meso-diaminopimelate containing): PWY0-1586
    • 2 reactions found over 12 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-16659&oldid=41849"