Difference between revisions of "CPD-6702"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8022 RXN-8022] == * direction: ** LEFT-TO-RIGHT * Synonym(s): ** Crtlb ** phytoene desaturase (...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1) * common name: *...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] == |
− | * | + | * smiles: |
− | ** | + | ** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1) |
+ | * common name: | ||
+ | ** 1D-myo-inositol 6-monophosphate | ||
+ | * inchi key: | ||
+ | ** InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L | ||
+ | * molecular weight: | ||
+ | ** 258.121 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Ins(6)P1 |
− | + | ** 1D-myo-inositol 6-phosphate | |
− | ** | + | ** Ins(6)P |
− | ** | + | ** Ins6P |
− | ** | + | ** D-myo-inositol 6-monophosphate |
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-10954]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203035 25203035] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64841 64841] |
− | {{#set: | + | {{#set: smiles=C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)}} |
− | + | {{#set: common name=1D-myo-inositol 6-monophosphate}} | |
− | {{#set: | + | {{#set: inchi key=InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L}} |
− | {{#set: | + | {{#set: molecular weight=258.121 }} |
− | {{#set: | + | {{#set: common name=Ins(6)P1|1D-myo-inositol 6-phosphate|Ins(6)P|Ins6P|D-myo-inositol 6-monophosphate}} |
− | {{#set: | + | {{#set: consumed by=RXN-10954}} |
− | {{#set: | + |
Latest revision as of 19:28, 21 March 2018
Contents
Metabolite CPD-6702
- smiles:
- C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)
- common name:
- 1D-myo-inositol 6-monophosphate
- inchi key:
- InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L
- molecular weight:
- 258.121
- Synonym(s):
- Ins(6)P1
- 1D-myo-inositol 6-phosphate
- Ins(6)P
- Ins6P
- D-myo-inositol 6-monophosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)" cannot be used as a page name in this wiki.