Difference between revisions of "CPD-6702"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1) * common name: *...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] ==
 
* smiles:
 
* smiles:
−
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)
 
* common name:
 
* common name:
−
** chlorophyllide a
+
** 1D-myo-inositol 6-monophosphate
 +
* inchi key:
 +
** InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L
 
* molecular weight:
 
* molecular weight:
−
** 612.967    
+
** 258.121    
 
* Synonym(s):
 
* Synonym(s):
−
** chlorophyllide
+
** Ins(6)P1
 +
** 1D-myo-inositol 6-phosphate
 +
** Ins(6)P
 +
** Ins6P
 +
** D-myo-inositol 6-monophosphate
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-7663]]
+
* [[RXN-10954]]
−
* [[RXN-7676]]
+
−
* [[RXN-13398]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-5286]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[RXN1F-10]]
 
−
* [[RXN1F-66]]
 
 
== External links  ==
 
== External links  ==
−
* CAS : 14897-06-4
 
 
* PUBCHEM:
 
* PUBCHEM:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54729368 54729368]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203035 25203035]
 
* CHEBI:
 
* CHEBI:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83348 83348]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64841 64841]
−
* LIGAND-CPD:
+
{{#set: smiles=C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02139 C02139]
+
{{#set: common name=1D-myo-inositol 6-monophosphate}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L}}
−
{{#set: common name=chlorophyllide a}}
+
{{#set: molecular weight=258.121    }}
−
{{#set: molecular weight=612.967    }}
+
{{#set: common name=Ins(6)P1|1D-myo-inositol 6-phosphate|Ins(6)P|Ins6P|D-myo-inositol 6-monophosphate}}
−
{{#set: common name=chlorophyllide}}
+
{{#set: consumed by=RXN-10954}}
−
{{#set: consumed by=RXN-7663|RXN-7676|RXN-13398}}
+
−
{{#set: produced by=RXN-5286}}
+
−
{{#set: consumed or produced by=RXN1F-10|RXN1F-66}}
+

Latest revision as of 19:28, 21 March 2018

Metabolite CPD-6702

  • smiles:
    • C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)
  • common name:
    • 1D-myo-inositol 6-monophosphate
  • inchi key:
    • InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L
  • molecular weight:
    • 258.121
  • Synonym(s):
    • Ins(6)P1
    • 1D-myo-inositol 6-phosphate
    • Ins(6)P
    • Ins6P
    • D-myo-inositol 6-monophosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-6702&oldid=41858"