Difference between revisions of "PWY-6949"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12513 CPD-12513] == * smiles: ** C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6949 PWY-6949] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-33...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12513 CPD-12513] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6949 PWY-6949] ==
* smiles:
+
* taxonomic range:
** C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-3398]
* inchi key:
+
** InChIKey=DQQDLYVHOTZLOR-IAZOVDBXSA-L
+
 
* common name:
 
* common name:
** UDP-β-L-arabinopyranose
+
** DIBOA-glucoside biosynthesis
* molecular weight:
+
** 534.263   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** DIBOA biosynthesis
 +
** DIBOA-Glc biosynthesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''6''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[RXN0-2381]]
* [[UDP-ARABINOSE-4-EPIMERASE-RXN]]
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_17207]]
 +
*** [[Tiso_gene_4604]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-6681 RXN-6681]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-6682 RXN-6682]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-6683 RXN-6683]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-6684 RXN-6684]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7021 RXN-7021]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-3398}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246220 25246220]
+
{{#set: common name=DIBOA-glucoside biosynthesis}}
* CHEBI:
+
{{#set: common name=DIBOA biosynthesis|DIBOA-Glc biosynthesis}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61457 61457]
+
{{#set: reaction found=1}}
{{#set: smiles=C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3)}}
+
{{#set: total reaction=6}}
{{#set: inchi key=InChIKey=DQQDLYVHOTZLOR-IAZOVDBXSA-L}}
+
{{#set: completion rate=17.0}}
{{#set: common name=UDP-β-L-arabinopyranose}}
+
{{#set: molecular weight=534.263    }}
+
{{#set: consumed or produced by=UDP-ARABINOSE-4-EPIMERASE-RXN}}
+

Latest revision as of 19:28, 21 March 2018

Pathway PWY-6949

  • taxonomic range:
  • common name:
    • DIBOA-glucoside biosynthesis
  • Synonym(s):
    • DIBOA biosynthesis
    • DIBOA-Glc biosynthesis

Reaction(s) found

1 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links