Difference between revisions of "Tiso gene 10809"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-21 CPD66-21] == * smiles: ** CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O...")
(Created page with "Category:Gene == Gene Tiso_gene_10809 == * right end position: ** 3307 * transcription direction: ** POSITIVE * left end position: ** 36 * centisome position: ** 0.3136435...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-21 CPD66-21] ==
+
== Gene Tiso_gene_10809 ==
−
* smiles:
+
* right end position:
−
** CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O)O
+
** 3307
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YEESKJGWJFYOOK-IJHYULJSSA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** leukotriene-D4
+
** 36
−
* molecular weight:
+
* centisome position:
−
** 495.653    
+
** 0.3136435    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ISOCITDEH-RXN]]
−
* [[RXN66-336]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-8642]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-9951]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-5913]]
 +
* [[REDCITCYC]]
 +
* [[PWY-7268]]
 +
* [[P23-PWY]]
 +
* [[P105-PWY]]
 +
* [[PWY-6969]]
 +
* [[FERMENTATION-PWY]]
 +
* [[PWY-6728]]
 +
* [[PWY-6549]]
 +
* [[PWY-7254]]
 +
* [[PWY-7124]]
 +
* [[TCA]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=3307}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940265 52940265]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=36}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63166 63166]
+
{{#set: centisome position=0.3136435    }}
−
{{#set: smiles=CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O)O}}
+
{{#set: reaction associated=ISOCITDEH-RXN|RXN-8642|RXN-9951}}
−
{{#set: inchi key=InChIKey=YEESKJGWJFYOOK-IJHYULJSSA-M}}
+
{{#set: pathway associated=PWY-5913|REDCITCYC|PWY-7268|P23-PWY|P105-PWY|PWY-6969|FERMENTATION-PWY|PWY-6728|PWY-6549|PWY-7254|PWY-7124|TCA}}
−
{{#set: common name=leukotriene-D4}}
+
−
{{#set: molecular weight=495.653    }}
+
−
{{#set: produced by=RXN66-336}}
+

Latest revision as of 19:29, 21 March 2018

Gene Tiso_gene_10809

  • right end position:
    • 3307
  • transcription direction:
    • POSITIVE
  • left end position:
    • 36
  • centisome position:
    • 0.3136435
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_10809&oldid=41876"