Difference between revisions of "DHAP pi thr"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1) * inchi key: **...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DHAP_pi_thr DHAP_pi_thr] == * direction: ** REVERSIBLE * common name: ** Dihydroxyacetone phosphate...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DHAP_pi_thr DHAP_pi_thr] ==
−
* smiles:
+
* direction:
−
** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L
+
 
* common name:
 
* common name:
−
** 1D-myo-inositol 6-monophosphate
+
** Dihydroxyacetone phosphate transport via triose-phosphate translocator (from chloroplast)
−
* molecular weight:
+
−
** 258.121   
+
 
* Synonym(s):
 
* Synonym(s):
−
** Ins(6)P1
 
−
** 1D-myo-inositol 6-phosphate
 
−
** Ins(6)P
 
−
** Ins6P
 
−
** D-myo-inositol 6-monophosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-10954]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[DIHYDROXY-ACETONE-PHOSPHATE]][c] '''+''' 1.0 [[Pi]][h] '''<=>''' 1.0 [[DIHYDROXY-ACETONE-PHOSPHATE]][h] '''+''' 1.0 [[Pi]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 glycerone phosphate[c] '''+''' 1.0 phosphate[h] '''<=>''' 1.0 glycerone phosphate[h] '''+''' 1.0 phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_5890]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_17661]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_6426]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203035 25203035]
+
{{#set: common name=Dihydroxyacetone phosphate transport via triose-phosphate translocator (from chloroplast)}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_5890|Tiso_gene_17661|Tiso_gene_6426}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64841 64841]
+
{{#set: in pathway=}}
−
{{#set: smiles=C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-XCMZKKERSA-L}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: common name=1D-myo-inositol 6-monophosphate}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=258.121    }}
+
−
{{#set: common name=Ins(6)P1|1D-myo-inositol 6-phosphate|Ins(6)P|Ins6P|D-myo-inositol 6-monophosphate}}
+
−
{{#set: consumed by=RXN-10954}}
+

Latest revision as of 19:29, 21 March 2018

Reaction DHAP_pi_thr

  • direction:
    • REVERSIBLE
  • common name:
    • Dihydroxyacetone phosphate transport via triose-phosphate translocator (from chloroplast)
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DHAP_pi_thr&oldid=41879"