Difference between revisions of "CPD-12513"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-21 CPD66-21] == * smiles: ** CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12513 CPD-12513] == * smiles: ** C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12513 CPD-12513] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3) |
* common name: | * common name: | ||
| − | ** | + | ** UDP-β-L-arabinopyranose |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=DQQDLYVHOTZLOR-IAZOVDBXSA-L |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 534.263 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[UDP-ARABINOSE-4-EPIMERASE-RXN]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246220 25246220] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61457 61457] |
| − | {{#set: smiles= | + | {{#set: smiles=C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3)}} |
| − | {{#set: common name= | + | {{#set: common name=UDP-β-L-arabinopyranose}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=DQQDLYVHOTZLOR-IAZOVDBXSA-L}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=534.263 }} |
| − | {{#set: | + | {{#set: reversible reaction associated=UDP-ARABINOSE-4-EPIMERASE-RXN}} |
Latest revision as of 19:29, 21 March 2018
Contents
Metabolite CPD-12513
- smiles:
- C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3)
- common name:
- UDP-β-L-arabinopyranose
- inchi key:
- InChIKey=DQQDLYVHOTZLOR-IAZOVDBXSA-L
- molecular weight:
- 534.263
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3)" cannot be used as a page name in this wiki.
