Difference between revisions of "GLYCERONE-KINASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCERONE-KINASE-RXN GLYCERONE-KINASE-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** -dihy...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCERONE-KINASE-RXN GLYCERONE-KINASE-RXN] ==
−
* smiles:
+
* direction:
−
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** chlorophyllide a
+
** -dihydroxy-2-butanone_kinase
−
* molecular weight:
+
* ec number:
−
** 612.967   
+
** [http://enzyme.expasy.org/EC/2.7.1.29 EC-2.7.1.29]
 
* Synonym(s):
 
* Synonym(s):
−
** chlorophyllide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-7663]]
+
* With identifiers:
−
* [[RXN-7676]]
+
** 1 [[ATP]][c] '''+''' 1 [[DIHYDROXYACETONE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[DIHYDROXY-ACETONE-PHOSPHATE]][c] '''+''' 1 [[ADP]][c]
−
* [[RXN-13398]]
+
* With common name(s):
−
== Reaction(s) known to produce the compound ==
+
** 1 ATP[c] '''+''' 1 dihydroxyacetone[c] '''=>''' 1 H+[c] '''+''' 1 glycerone phosphate[c] '''+''' 1 ADP[c]
−
* [[RXN-5286]]
+
 
−
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
−
* [[RXN1F-10]]
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[RXN1F-66]]
+
* Gene: [[Tiso_gene_14441]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6131]], glycerol degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6131 PWY-6131]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
* [[P185-PWY]], formaldehyde assimilation III (dihydroxyacetone cycle): [http://metacyc.org/META/NEW-IMAGE?object=P185-PWY P185-PWY]
 +
** '''11''' reactions found over '''12''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 14897-06-4
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15773 15773]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54729368 54729368]
+
* LIGAND-RXN:
−
* CHEBI:
+
** [http://www.genome.jp/dbget-bin/www_bget?R01011 R01011]
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83348 83348]
+
* UNIPROT:
−
* LIGAND-CPD:
+
** [http://www.uniprot.org/uniprot/P43550 P43550]
−
** [http://www.genome.jp/dbget-bin/www_bget?C02139 C02139]
+
** [http://www.uniprot.org/uniprot/O13902 O13902]
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: common name=chlorophyllide a}}
+
{{#set: common name=-dihydroxy-2-butanone_kinase}}
−
{{#set: molecular weight=612.967    }}
+
{{#set: ec number=EC-2.7.1.29}}
−
{{#set: common name=chlorophyllide}}
+
{{#set: gene associated=Tiso_gene_14441}}
−
{{#set: consumed by=RXN-7663|RXN-7676|RXN-13398}}
+
{{#set: in pathway=PWY-6131|P185-PWY}}
−
{{#set: produced by=RXN-5286}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: reversible reaction associated=RXN1F-10|RXN1F-66}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 20:29, 21 March 2018

Reaction GLYCERONE-KINASE-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • -dihydroxy-2-butanone_kinase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6131, glycerol degradation II: PWY-6131
    • 1 reactions found over 2 reactions in the full pathway
  • P185-PWY, formaldehyde assimilation III (dihydroxyacetone cycle): P185-PWY
    • 11 reactions found over 12 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=GLYCERONE-KINASE-RXN&oldid=41914"