Difference between revisions of "RXN0-363"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-36 CPDQT-36] == * smiles: ** C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-] * inchi key: ** InChIKey=SQ...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-363 RXN0-363] == * direction: ** LEFT-TO-RIGHT * common name: ** nucleoside_hydrolase * ec num...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-363 RXN0-363] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** nucleoside_hydrolase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/3.2.2.1 EC-3.2.2.1] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[XANTHOSINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[XANTHINE]][c] '''+''' 1 [[D-Ribofuranose]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1 xanthosine[c] '''+''' 1 H2O[c] '''=>''' 1 xanthine[c] '''+''' 1 D-ribofuranose[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_11910]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | * Gene: [[Tiso_gene_12995]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | * [[PWY-6596]], adenosine nucleotides degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6596 PWY-6596] | ||
| + | ** '''8''' reactions found over '''8''' reactions in the full pathway | ||
| + | * [[PWY-6607]], guanosine nucleotides degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6607 PWY-6607] | ||
| + | ** '''3''' reactions found over '''4''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27994 27994] |
| − | * | + | * LIGAND-RXN: |
| − | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02143 R02143] |
| − | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | {{#set: | + | {{#set: common name=nucleoside_hydrolase}} |
| − | {{#set: | + | {{#set: ec number=EC-3.2.2.1}} |
| − | {{#set: | + | {{#set: gene associated=Tiso_gene_11910|Tiso_gene_12995}} |
| − | {{#set: | + | {{#set: in pathway=PWY-6596|PWY-6607}} |
| − | {{#set: | + | {{#set: reconstruction category=annotation}} |
| − | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation}} |
| + | {{#set: reconstruction tool=pathwaytools}} | ||
Latest revision as of 19:29, 21 March 2018
Contents
Reaction RXN0-363
- direction:
- LEFT-TO-RIGHT
- common name:
- nucleoside_hydrolase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 XANTHOSINE[c] + 1 WATER[c] => 1 XANTHINE[c] + 1 D-Ribofuranose[c]
- With common name(s):
- 1 xanthosine[c] + 1 H2O[c] => 1 xanthine[c] + 1 D-ribofuranose[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_11910
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_12995
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-6596, adenosine nucleotides degradation I: PWY-6596
- 8 reactions found over 8 reactions in the full pathway
- PWY-6607, guanosine nucleotides degradation I: PWY-6607
- 3 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
